Dipropylcarbamic acid chloride
dipropylcarbamoyl chloride
CAS: 27086-19-7
Molecular Formula: C7H14ClNO
Dipropylcarbamic acid chloride - Names and Identifiers
| Name | dipropylcarbamoyl chloride |
| Synonyms | dipropylcarbamic chloride dipropylcarbamoyl chloride Dipropylcarbamoyl chloride Dipropylcarbamic acid chloride Carbamic chloride, N,N-dipropyl- |
| CAS | 27086-19-7 |
| EINECS | 248-217-1 |
| InChI | InChI=1/C7H14ClNO/c1-3-5-9(6-4-2)7(8)10/h3-6H2,1-2H3 |
Dipropylcarbamic acid chloride - Physico-chemical Properties
| Molecular Formula | C7H14ClNO |
| Molar Mass | 163.65 |
| Density | 1.023g/cm3 |
| Boling Point | 226°C at 760 mmHg |
| Flash Point | 90.5°C |
| Vapor Presure | 0.084mmHg at 25°C |
| Refractive Index | 1.451 |
Dipropylcarbamic acid chloride - Introduction
Diproylcarbamoyl chloride, chemical formula C7H14ClNO, is an organic compound. The following is a description of its nature, use, preparation and safety information:
Nature:
diproylcarbamoyl chloride is a colorless to pale yellow liquid with a pungent odor. It has a high boiling point and melting point, and is unstable at room temperature, easily decomposes and reacts with water.
Use:
diproylcarbamoyl chloride is an important organic synthesis intermediate. It is often used in synthetic chemistry to synthesize other compounds, such as drugs, pesticides and dyes. It can be used as an acylation reagent in organic synthesis reactions.
Method:
dipropylcarbamoyl chloride can be prepared by reacting dipropylcarbamic acid with acid chloride. The specific synthesis path is as follows:
C3H7NHCH2COOH SOCl2 → C3H7NHCH2COCl SO2 HCl
Safety Information:
diproylcarbamoyl chloride needs to pay attention to safety measures during operation. It is an irritating compound that is corrosive to the skin and eyes and can cause burns and irritation. Avoid direct contact with skin and eyes, and pay attention to the use of personal protective equipment, such as gloves, goggles and laboratory coats. In addition, it is also a flammable liquid and should be kept away from open flames and heat sources to prevent fire or explosion accidents.
Nature:
diproylcarbamoyl chloride is a colorless to pale yellow liquid with a pungent odor. It has a high boiling point and melting point, and is unstable at room temperature, easily decomposes and reacts with water.
Use:
diproylcarbamoyl chloride is an important organic synthesis intermediate. It is often used in synthetic chemistry to synthesize other compounds, such as drugs, pesticides and dyes. It can be used as an acylation reagent in organic synthesis reactions.
Method:
dipropylcarbamoyl chloride can be prepared by reacting dipropylcarbamic acid with acid chloride. The specific synthesis path is as follows:
C3H7NHCH2COOH SOCl2 → C3H7NHCH2COCl SO2 HCl
Safety Information:
diproylcarbamoyl chloride needs to pay attention to safety measures during operation. It is an irritating compound that is corrosive to the skin and eyes and can cause burns and irritation. Avoid direct contact with skin and eyes, and pay attention to the use of personal protective equipment, such as gloves, goggles and laboratory coats. In addition, it is also a flammable liquid and should be kept away from open flames and heat sources to prevent fire or explosion accidents.
Last Update：2024-04-09 20:52:54
