ETHYL (S)-1-CBZ-NIPECOTATE - Names and Identifiers
Name | Ethyl (S)-1-Cbz-Nipecotate
|
Synonyms | Ethyl (S)-1-Cbz-Nipecotate ETHYL (S)-1-CBZ-NIPECOTATE (S)-1-Benzyl 3-ethyl piperidine-1,3- 1-Benzyl3-ethyl(S)-piperidine-1,3-dicarboxylate (S)-1-Benzyl 3-ethyl piperidine-1,3-dicarboxylate O1-benzyl O3-ethyl (3S)-piperidine-1,3-dicarboxylate 3-ethyl-1-phenylmethoxycarbonyl-3-piperidinecarboxylic acid (S)-1,3-Piperidinedicarboxylic acid 3-ethyl 1-(phenylmethyl) ester 1,3-Piperidinedicarboxylic acid, 3-ethyl 1-(phenylmethyl) ester, (3S)-
|
CAS | 174699-11-7
|
InChI | InChI=1/C16H21NO4/c1-2-20-15(18)14-9-6-10-17(11-14)16(19)21-12-13-7-4-3-5-8-13/h3-5,7-8,14H,2,6,9-12H2,1H3/t14-/m0/s1 |
ETHYL (S)-1-CBZ-NIPECOTATE - Physico-chemical Properties
Molecular Formula | C16H21NO4
|
Molar Mass | 291.34 |
Density | 1.165g/cm3 |
Boling Point | 403.7°C at 760 mmHg |
Flash Point | 198°C |
Vapor Presure | 9.97E-07mmHg at 25°C |
Storage Condition | Sealed in dry,Room Temperature |
Refractive Index | 1.533 |
Physical and Chemical Properties | |
ETHYL (S)-1-CBZ-NIPECOTATE - Introduction
Ethyl (S)-1-Cbz-Nipecotate, fully known as S-1-amino -3-(methoxycarbonylphenyl) piperidine -1-carboxylic acid acetic acid, is a compound. Its nature is as follows:
1. Appearance: Ethyl (S)-1-Cbz-Nipecotate is a white to slightly yellow crystalline powder.
2. Solubility: It has good solubility in common organic solvents.
Ethyl (S)-1-Cbz-Nipecotate uses mainly include the following aspects:
1. Synthetic intermediates: as intermediates in organic synthesis, it can be used to synthesize various drugs, pesticides and other compounds.
2. Research field: It is also commonly used in the laboratory as a reagent to protect organic compounds or change the nature of the reaction.
The preparation method of Ethyl (S)-1-Cbz-Nipecotate is relatively complicated and is generally obtained by chemical synthesis. The specific preparation method can refer to the relevant organic synthesis manual or literature.
Regarding the safety information of Ethyl (S)-1-Cbz-Nipecotate, please note the following points:
1. Direct contact with skin and eyes may cause irritation, should take appropriate protective measures.
2. When using or handling the compound, it should be placed in a well-ventilated place to avoid inhaling its dust.
3. Due to its unknown toxicity, users should read and follow the relevant safety instructions and use personal protective equipment.
4. If it is leaked or ingested, seek medical help immediately and bring the product label or safety data sheet.
Last Update:2024-04-10 22:40:09