ETHYL METHYLPHOSPHINATE
ETHYL METHYLPHOSPHINATE
CAS: 16391-07-4
Molecular Formula: C3H9O2P
ETHYL METHYLPHOSPHINATE - Names and Identifiers
| Name | ETHYL METHYLPHOSPHINATE |
| Synonyms | ETHYL METHYLPHOSPHINATE ethoxy(methyl)oxophosphonium Ethoxy-methyl-oxophosphanium 1-methylphosphonoyloxyethane METHYLPHOSPHINIC ACID ETHYL ESTER Phosphinic acid,P-Methyl-, ethyl ester |
| CAS | 16391-07-4 |
| InChI | InChI=1/C3H9O2P/c1-3-5-6(2)4/h6H,3H2,1-2H3 |
ETHYL METHYLPHOSPHINATE - Physico-chemical Properties
| Molecular Formula | C3H9O2P |
| Molar Mass | 108.08 |
| Density | 1.0511 g/cm3 |
| Boling Point | 70 °C(Press: 15 Torr) |
| Flash Point | 36.579°C |
| Vapor Presure | 22.395mmHg at 25°C |
ETHYL METHYLPHOSPHINATE - Introduction
ETHYL METHYLPHOSPHINATE, also known as methyl tert-butyl chlorocarbonylphosphonate, has the following properties:
1. Appearance and odor: ETHYL METHYLPHOSPHINATE is a colorless to light yellow liquid with an oil-like odor.
2. Stability: It is relatively stable at room temperature, but may decompose when heated or in contact with flame.
3. Solubility: It is soluble in organic solvents, such as ethanol, ether and chlorinated hydrocarbons, but almost insoluble in water.
The main uses of ETHYL METHYLPHOSPHINATE include:
1. Fire retardant: Because of its characteristics of inhibiting combustion, it is often used as a fire retardant for polymers and other combustible materials.
2. Solvent: Due to its good solubility, it can be used as a solvent in organic synthesis and is commonly used in the preparation of pesticides, drugs and dyes.
The common method for preparing ETHYL METHYLPHOSPHINATE is to react phosphorus trichloride with ethanol to form a product, which is then purified by extraction and distillation.
ETHYL METHYLPHOSPHINATE has certain security risks. Please note the following:
1. Toxicity: ETHYL METHYLPHOSPHINATE has certain toxicity and can be absorbed through the skin or inhaled to cause harm to the human body. Appropriate protective measures should be taken during use, such as wearing gloves, protective glasses and breathing apparatus.
2. Flammability: ETHYL METHYLPHOSPHINATE is flammable and can form an explosive mixture with air. Avoid exposure to open flames, heat sources and oxygen during storage and use.
3. Environmental impact: ETHYL METHYLPHOSPHINATE has certain ecological toxicity to water and soil, and should be avoided from entering the environment uncontrollably.
When handling ETHYL METHYLPHOSPHINATE, please follow relevant safety guidelines and ensure that appropriate laboratory equipment and knowledge are available.
1. Appearance and odor: ETHYL METHYLPHOSPHINATE is a colorless to light yellow liquid with an oil-like odor.
2. Stability: It is relatively stable at room temperature, but may decompose when heated or in contact with flame.
3. Solubility: It is soluble in organic solvents, such as ethanol, ether and chlorinated hydrocarbons, but almost insoluble in water.
The main uses of ETHYL METHYLPHOSPHINATE include:
1. Fire retardant: Because of its characteristics of inhibiting combustion, it is often used as a fire retardant for polymers and other combustible materials.
2. Solvent: Due to its good solubility, it can be used as a solvent in organic synthesis and is commonly used in the preparation of pesticides, drugs and dyes.
The common method for preparing ETHYL METHYLPHOSPHINATE is to react phosphorus trichloride with ethanol to form a product, which is then purified by extraction and distillation.
ETHYL METHYLPHOSPHINATE has certain security risks. Please note the following:
1. Toxicity: ETHYL METHYLPHOSPHINATE has certain toxicity and can be absorbed through the skin or inhaled to cause harm to the human body. Appropriate protective measures should be taken during use, such as wearing gloves, protective glasses and breathing apparatus.
2. Flammability: ETHYL METHYLPHOSPHINATE is flammable and can form an explosive mixture with air. Avoid exposure to open flames, heat sources and oxygen during storage and use.
3. Environmental impact: ETHYL METHYLPHOSPHINATE has certain ecological toxicity to water and soil, and should be avoided from entering the environment uncontrollably.
When handling ETHYL METHYLPHOSPHINATE, please follow relevant safety guidelines and ensure that appropriate laboratory equipment and knowledge are available.
Last Update：2024-04-09 21:04:16
