Name | Aceticacidphenoxyethylester |
Synonyms | PHENOXYETHYL ACETATE 2-PHENOXYETHYL ACETATE 2-Phenoxyethyl acetate 2-phenoxyethanolacetate 2-phenoxy-ethanoacetate aceticacidphenoxyethylester Aceticacidphenoxyethylester Acetic acid 2-phenoxyethyl ester ACETIC ACID 2-PHENOXYETHYL ESTER 2-phenoxyethylesterkyselinyoctove ETHYLENE GLYCOL MONOPHENYL ETHER ACETATE |
CAS | 6192-44-5 |
InChI | InChI=1/C10H12O3/c1-9(11)12-7-8-13-10-5-3-2-4-6-10/h2-6H,7-8H2,1H3 |
Molecular Formula | C10H12O3 |
Molar Mass | 180.2 |
Density | 1,11 g/cm3 |
Boling Point | 273.02°C (rough estimate) |
Flash Point | 141°C |
Vapor Presure | 0.0318mmHg at 25°C |
Appearance | clear liquid |
Color | Colorless to Almost colorless |
Storage Condition | 2-8°C |
Refractive Index | 1.5060-1.5100 |
MDL | MFCD00059336 |
Use | Can be used as solvents, chemical intermediates, preparation of photosensitizer, photopolymerization initiator, liquid crystal orientation agent, insect repellent, etc |
RTECS | KM0525000 |
EPA chemical substance information | information provided by: ofmpeb.epa.gov (external link) |
Use | as a solvent, can be used for the preparation of photosensitizer, photopolymerization initiator, liquid crystal orientation agent, insect repellent, etc. can be used as solvent, chemical intermediate, preparation of photosensitizer, photopolymerization initiator, liquid crystal orientation agent, insect repellent, etc. |