Ethanone, 1-(4-chlorophenyl)-2-hydroxy-2-phenyl-
1-(4-chlorophenyl)-2-hydroxy-2-phenylethanone
CAS: 39774-18-0
Molecular Formula: C14H11ClO2
Ethanone, 1-(4-chlorophenyl)-2-hydroxy-2-phenyl- - Names and Identifiers
| Name | 1-(4-chlorophenyl)-2-hydroxy-2-phenylethanone |
| Synonyms | 4-CHLOROBENZOIN 1-(4-CHLOROPHENYL)-2-HYDROXY-2-PHENYLETHANONE 1-(4-chlorophenyl)-2-hydroxy-2-phenylethanone Ethanone, 1-(4-chlorophenyl)-2-hydroxy-2-phenyl- 4-Chlorobenzoin,1-(4-Chlorophenyl)-2-hydroxy-2-phenylethanone |
| CAS | 39774-18-0 |
| InChI | InChI=1/C14H11ClO2/c15-12-8-6-11(7-9-12)14(17)13(16)10-4-2-1-3-5-10/h1-9,13,16H |
Ethanone, 1-(4-chlorophenyl)-2-hydroxy-2-phenyl- - Physico-chemical Properties
| Molecular Formula | C14H11ClO2 |
| Molar Mass | 246.69 |
| Density | 1.285±0.06 g/cm3(Predicted) |
| Melting Point | 89-93°C(lit.) |
| Boling Point | 407.1±30.0 °C(Predicted) |
| Flash Point | 200.006°C |
| Vapor Presure | 0mmHg at 25°C |
| pKa | 11.82±0.20(Predicted) |
| Refractive Index | 1.618 |
Ethanone, 1-(4-chlorophenyl)-2-hydroxy-2-phenyl- - Risk and Safety
| Hazard Symbols | Xn - Harmful |
| Risk Codes | 22 - Harmful if swallowed |
| Safety Description | 36/37 - Wear suitable protective clothing and gloves. |
| WGK Germany | 3 |
