FENTAMINE DMA-O
N,N-dimethyloctadecenylamine
CAS: 28061-69-0
Molecular Formula: C20H41N
FENTAMINE DMA-O - Names and Identifiers
| Name | N,N-dimethyloctadecenylamine |
| Synonyms | FENTAMINE DMA-O Dimethyloleylamine Oleyl dimethyl amine N,N-dimethyloctadecenylamine N,N-Dimethyloctadecen-1-amine N,N-Dimethyloctadecen-1-amine N,N-dimethyl-1-octadecen-1-amine Octadecen-1-amine, N,N-dimethyl- N,N-dimethyloctadec-17-en-1-amine |
| CAS | 28061-69-0 |
| EINECS | 248-811-0 |
| InChI | InChI=1/C20H41N/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21(2)3/h4H,1,5-20H2,2-3H3 |
FENTAMINE DMA-O - Physico-chemical Properties
| Molecular Formula | C20H41N |
| Molar Mass | 295.55 |
| Density | 0.818g/cm3 |
| Boling Point | 364°C at 760 mmHg |
| Flash Point | 156.8°C |
| Vapor Presure | 1.74E-05mmHg at 25°C |
| Refractive Index | 1.456 |
| Use | Production of softeners and other surfactants |
FENTAMINE DMA-O - Reference Information
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |
| use | production of surfactants such as softeners |
Last Update：2024-04-09 21:21:28
