Filbertone G
5-methyl-2-hepten-4-one
CAS: 81925-81-7
Molecular Formula: C8H14O
Filbertone G - Names and Identifiers
| Name | 5-methyl-2-hepten-4-one |
| Synonyms | FILBERTONE Filbertone G Filbert Heptenone 5-METHYL-2-HEPT-4-ONE 5-methyl-2-hepten-4-on 5-methyl-2-hepten-4-one 5-methylhept-2-en-4-one 2-hepten-4-one,5-methyl- (2E,5R)-5-methylhept-2-en-4-one |
| CAS | 81925-81-7 |
| InChI | InChI=1/C8H14O/c1-4-6-8(9)7(3)5-2/h4,6-7H,5H2,1-3H3/b6-4+/t7-/m1/s1 |
Filbertone G - Physico-chemical Properties
| Molecular Formula | C8H14O |
| Molar Mass | 126.2 |
| Density | 0.845g/mLat 25°C(lit.) |
| Melting Point | -66.9°C (estimate) |
| Boling Point | 170°C(lit.) |
| Flash Point | 126°F |
| JECFA Number | 1133 |
| Vapor Presure | 1.25mmHg at 25°C |
| Refractive Index | n20/D 1.444(lit.) |
Filbertone G - Risk and Safety
| Risk Codes | 10 - Flammable |
| Safety Description | 16 - Keep away from sources of ignition. |
| UN IDs | UN 1993 3/PG 1 |
| WGK Germany | 3 |
| TSCA | Yes |
| Hazard Class | 3 |
| Packing Group | III |
Filbertone G - Reference Information
| FEMA | 3761 | 5-METHYL-2-HEPTEN-4-ONE |
| EPA chemical substance information | information is provided by: ofmpeb.epa.gov (external link) |
Last Update：2024-04-09 20:52:54
