Name | N-(2-methylpropanoyl)guanosine |
Synonyms | ibu-rG N2-iBu-rG N-Isobutyrylguanosine N-Isobutyryl guanosine N2-Isobutyrylguanosine N2-Isobutyryl-guanosine N2-(ISOBUTYRYL)-GUANOSINE N2-ISOBUTYRYL-D-GUANOSINE N-(2-methylpropanoyl)guanosine N2-(2-Methylpropanoyl)-Guanosine N2-(2-METHYLPROPANOYL)-GUANOSINE N-(2-Methyl-1-oxopropyl)guanosine N2-ISOBUTYRYLGUANOSINE MONOHYDRATE Guanosine, N-(2-methyl-1-oxopropyl)- |
CAS | 64350-24-9 |
EINECS | 2017-001-1 |
InChI | InChI=1/C14H19N5O6/c1-5(2)11(23)17-14-16-10-7(12(24)18-14)15-4-19(10)13-9(22)8(21)6(3-20)25-13/h4-6,8-9,13,20-22H,3H2,1-2H3,(H2,16,17,18,23,24)/t6-,8-,9-,13-/m1/s1 |
Molecular Formula | C14H19N5O6 |
Molar Mass | 353.33 |
Density | 1.82±0.1 g/cm3(Predicted) |
Melting Point | 148 °C |
Solubility | DMSO (Slightly), Methanol (Slightly) |
Appearance | Solid |
Color | White to Off-White |
pKa | 9.16±0.20(Predicted) |
Storage Condition | Sealed in dry,2-8°C |
Refractive Index | 1.777 |
MDL | MFCD00274102 |
HS Code | 29389090 |
use | N2-isobutyryl guanosine monohydrate is an important derivative of it, is an important intermediate of food and pharmaceutical products, and can be used to synthesize food fresheners: 5 '-guanosine acid disodium, sodium nucleoside acid disodium and nucleoside antiviral drugs such as ribavirin, acyclovir, etc. |
synthesis method | guanosine is used as raw material to react with isobutyryl chloride to obtain N2-isobutyryl guanosine monohydrate. Or use guanosine and isobutyric anhydride as starting materials to prepare the target compound N2-isobutyryl guanosine monohydrate through condensation reaction [1]. The synthesis reaction formula of N2-isobutyryl guanosine monohydrate is as follows: |