Iodoacetic acid chloride
Iodoacetyl chloride
CAS: 38020-81-4
Molecular Formula: C2H2ClIO
Iodoacetic acid chloride - Names and Identifiers
| Name | Iodoacetyl chloride |
| Synonyms | IODOACETYL CHLORIDE Iodoacetyl chloride iodoacetic chloride 2-iodoacetyl chloride Iodoacetic acid chloride Acetyl chloride, 2-iodo- |
| CAS | 38020-81-4 |
| EINECS | 253-748-7 |
| InChI | InChI=1/C2H2ClIO/c3-2(5)1-4/h1H2 |
Iodoacetic acid chloride - Physico-chemical Properties
| Molecular Formula | C2H2ClIO |
| Molar Mass | 204.39 |
| Density | 2,28 g/cm3 |
| Boling Point | 48-50°C 12mm |
| Flash Point | 48-50°C/12mm |
| Water Solubility | Miscible with water. |
| Vapor Presure | 1.89mmHg at 25°C |
| BRN | 1739078 |
| Storage Condition | 2-8℃ |
| Sensitive | Moisture & Light Sensitive |
| Refractive Index | 1.57 |
| MDL | MFCD00013718 |
Iodoacetic acid chloride - Risk and Safety
| Risk Codes | 34 - Causes burns |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. S45 - In case of accident or if you feel unwell, seek medical advice immediately (show the label whenever possible.) |
| UN IDs | 3265 |
| Hazard Class | 8 |
| Packing Group | II |
Iodoacetic acid chloride - Introduction
Iodoacetyl chloride is an organic compound with the chemical formula CH2IClCOOH. The following is a presentation of information on the nature, use, formulation and safety of Iodoacetyl chloride:
Nature:
1. appearance: Iodoacetyl chloride is a colorless to light yellow liquid.
2. density: the density of Iodoacetyl chloride is about 2.27 g/cm.
3. Melting point: The melting point of Iodoacetyl chloride is about -38°C.
4. Boiling point: The boiling point of Iodoacetyl chloride is about 107°C.
5. Solubility: Iodoacetyl chloride soluble in organic solvents, such as chloroform, carbon disulfide and ether.
Use:
Iodoacetyl chloride are often used as reagents in organic synthesis. Specific uses include:
1. As an alkylating agent, Iodoacetyl chloride can be used for the alkylation reaction of ethyl ester or alcohol to introduce iodine groups.
2. for the synthesis of compounds in the disulfide structure, such as the synthesis of some thioester amide compounds.
Preparation Method:
Iodoacetyl chloride can be obtained by chlorination of ethyl iodate and anhydrous chloride-free. The specific preparation steps are as follows:
1. Add ethyl iodate to reaction vessel.
2. Chloride solution is gradually added dropwise under the condition of no chloride.
3. After completion of the reaction, a Iodoacetyl chloride was obtained.
Safety Information:
1. Iodoacetyl the chloride has a pungent odor, should avoid inhalation of its vapor.
2. contact with the skin will cause burning sensation, do not touch the skin directly.
3. in the process of operation should pay attention to proper ventilation and protective measures, wear protective gloves, goggles and protective clothing.
4. storage should be sealed in a cool, dry place.
5. Waste disposal should be carried out in accordance with local regulations, do not dump or discharge.
Nature:
1. appearance: Iodoacetyl chloride is a colorless to light yellow liquid.
2. density: the density of Iodoacetyl chloride is about 2.27 g/cm.
3. Melting point: The melting point of Iodoacetyl chloride is about -38°C.
4. Boiling point: The boiling point of Iodoacetyl chloride is about 107°C.
5. Solubility: Iodoacetyl chloride soluble in organic solvents, such as chloroform, carbon disulfide and ether.
Use:
Iodoacetyl chloride are often used as reagents in organic synthesis. Specific uses include:
1. As an alkylating agent, Iodoacetyl chloride can be used for the alkylation reaction of ethyl ester or alcohol to introduce iodine groups.
2. for the synthesis of compounds in the disulfide structure, such as the synthesis of some thioester amide compounds.
Preparation Method:
Iodoacetyl chloride can be obtained by chlorination of ethyl iodate and anhydrous chloride-free. The specific preparation steps are as follows:
1. Add ethyl iodate to reaction vessel.
2. Chloride solution is gradually added dropwise under the condition of no chloride.
3. After completion of the reaction, a Iodoacetyl chloride was obtained.
Safety Information:
1. Iodoacetyl the chloride has a pungent odor, should avoid inhalation of its vapor.
2. contact with the skin will cause burning sensation, do not touch the skin directly.
3. in the process of operation should pay attention to proper ventilation and protective measures, wear protective gloves, goggles and protective clothing.
4. storage should be sealed in a cool, dry place.
5. Waste disposal should be carried out in accordance with local regulations, do not dump or discharge.
Last Update：2024-04-10 22:29:15
Supplier List
Product Name: Iodoacetyl Chloride Visit Supplier Webpage Request for quotation
CAS: 38020-81-4
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 38020-81-4
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
Product Name: Iodoacetyl Chloride Visit Supplier Webpage Request for quotation
CAS: 38020-81-4
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 38020-81-4
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
View History