Isopropylmalonic acid
Isopropylmalonic acid
CAS: 601-79-6
Molecular Formula: C6H10O4
Isopropylmalonic acid - Names and Identifiers
| Name | Isopropylmalonic acid |
| Synonyms | AURORA KA-6545 ISOPROPYLMALONIC ACID Isopropylmalonic acid isopropyl malonic acid 2-Isopropyl-malonic acid Isopropylpropanedioic acid 2-propan-2-ylpropanedioate (1-methylethyl)propanedioate propan-2-ylpropanedioic acid 2-(propan-2-yl)propanedioic acid |
| CAS | 601-79-6 |
| EINECS | 210-008-8 |
| InChI | InChI=1/C6H10O4/c1-3(2)4(5(7)8)6(9)10/h3-4H,1-2H3,(H,7,8)(H,9,10)/p-2 |
Isopropylmalonic acid - Physico-chemical Properties
| Molecular Formula | C6H10O4 |
| Molar Mass | 146.14 |
| Density | 1.242±0.06 g/cm3(Predicted) |
| Melting Point | 90 °C |
| Boling Point | 315.4±25.0 °C(Predicted) |
| Flash Point | 158.7°C |
| Vapor Presure | 9.44E-05mmHg at 25°C |
| BRN | 1723234 |
| pKa | pK1:2.94;pK2:5.88 (25°C) |
| Storage Condition | Sealed in dry,Room Temperature |
| MDL | MFCD00021717 |
Isopropylmalonic acid - Risk and Safety
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. |
| UN IDs | UN 2811 6.1/PG III |
| Hazard Class | 6.1 |
| Packing Group | III |
Isopropylmalonic acid - Introduction
Isopropylmalonic acid, also known as Isopropylmalonic acid, chemical formula C7H12O4, is an organic compound.
Nature:
1. Appearance: Isopropylmalonic acid is white crystalline powder or crystal.
2. melting point: about 100-103 ℃.
3. Solubility: Soluble in water, alcohol and ketone solvents, insoluble in non-polar solvents.
4. chemical properties: Isopropylmalonic acid is a kind of dicarboxylic acid, with acidic, can react with alkali to generate the corresponding salt.
Use:
1. synthetic intermediates: Isopropylmalonic acid can be used as organic synthesis intermediates for the manufacture of drugs, dyes and pesticides and other compounds.
2. process solvent: Isopropylmalonic acid can be used as the solvent and reaction medium of the solution.
3. Surfactant: Ester compounds made from Isopropylmalonic acid can be used to make surfactants.
Preparation Method:
A common method for preparing Isopropylmalonic acid is by the reaction of isopropyl acetate and diethyl succinate. Specific steps include ester exchange reaction and acid hydrolysis reaction.
Safety Information:
1. Isopropylmalonic acid has a stimulating effect on eyes and skin, rinse with plenty of water immediately after contact.
2. inhalation of Isopropylmalonic acid vapor can cause respiratory irritation, should maintain a well-ventilated environment.
3. when storing and handling Isopropylmalonic acid, care should be taken to prevent it from coming into contact with fire and oxidant.
Nature:
1. Appearance: Isopropylmalonic acid is white crystalline powder or crystal.
2. melting point: about 100-103 ℃.
3. Solubility: Soluble in water, alcohol and ketone solvents, insoluble in non-polar solvents.
4. chemical properties: Isopropylmalonic acid is a kind of dicarboxylic acid, with acidic, can react with alkali to generate the corresponding salt.
Use:
1. synthetic intermediates: Isopropylmalonic acid can be used as organic synthesis intermediates for the manufacture of drugs, dyes and pesticides and other compounds.
2. process solvent: Isopropylmalonic acid can be used as the solvent and reaction medium of the solution.
3. Surfactant: Ester compounds made from Isopropylmalonic acid can be used to make surfactants.
Preparation Method:
A common method for preparing Isopropylmalonic acid is by the reaction of isopropyl acetate and diethyl succinate. Specific steps include ester exchange reaction and acid hydrolysis reaction.
Safety Information:
1. Isopropylmalonic acid has a stimulating effect on eyes and skin, rinse with plenty of water immediately after contact.
2. inhalation of Isopropylmalonic acid vapor can cause respiratory irritation, should maintain a well-ventilated environment.
3. when storing and handling Isopropylmalonic acid, care should be taken to prevent it from coming into contact with fire and oxidant.
Last Update：2024-04-09 02:00:47
Supplier List
Product Name: Isopropylmalonic Acid Visit Supplier Webpage Request for quotation
CAS: 601-79-6
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 601-79-6
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
Product Name: Isopropylmalonic Acid Visit Supplier Webpage Request for quotation
CAS: 601-79-6
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 601-79-6
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
View History