Lauryl Chloroformate
Lauryl Chloroformate
CAS: 24460-74-0
Molecular Formula: C13H25ClO2
Lauryl Chloroformate - Names and Identifiers
| Name | Lauryl Chloroformate |
| Synonyms | Laurylchloroformate LAURYLCHLOPOFORMATE Lauryl Chloroformate LAURYL CHLOROFORMATE Dodecyl chloroformate DODECYL CHLOROFORMATE N-DODECYLCHLOROFORMATE dodecyl carbonochloridate CHLOROFORMIC ACID LAURYL ESTER CHLOROFORMIC ACID DODECYL ESTER chlorocarbonic acid lauryl ester |
| CAS | 24460-74-0 |
| EINECS | 246-272-6 |
| InChI | InChI=1/C13H25ClO2/c1-2-3-4-5-6-7-8-9-10-11-12-16-13(14)15/h2-12H2,1H3 |
Lauryl Chloroformate - Physico-chemical Properties
| Molecular Formula | C13H25ClO2 |
| Molar Mass | 248.79 |
| Density | 0.922g/mLat 25°C(lit.) |
| Boling Point | 168 °C / 20mmHg |
| Flash Point | 230°F |
| Vapor Presure | 1.33 mm Hg ( 20 °C) |
| Appearance | clear liquid |
| Color | Colorless to Light yellow |
| Refractive Index | n20/D 1.442(lit.) |
Lauryl Chloroformate - Risk and Safety
| Hazard Symbols | C - Corrosive |
| Risk Codes | 34 - Causes burns |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S27 - Take off immediately all contaminated clothing. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. |
| UN IDs | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| HS Code | 29159000 |
| Hazard Class | 8 |
| Packing Group | II |
Lauryl Chloroformate - Introduction
Lauryl Chloroformate, chemical formula C13H25ClO2, is an organic compound. The following is a description of the nature, use, formulation and safety information of Lauryl Chloroformate:
Nature:
1. Appearance: Lauryl chloroform is a colorless to pale yellow liquid.
2. Solubility: It is soluble in organic solvents such as ethanol and dimethylformamide, but insoluble in water.
3. Odor: a pungent smell.
Use:
1. Lauryl chloroform is a commonly used chemical reagent, which can be used as an acylation reagent in organic synthesis, for esterification reaction and preparation of ester compounds.
2. In organic synthesis, it can be used to synthesize surfactants, lubricants and dye intermediates.
3. Lauryl chloroform can also be used as a crosslinking agent in the polymer industry to increase the mechanical properties and thermal stability of the polymer.
Method:
Lauryl Chloroformate can be synthesized:
Lauryl Alcohol Phosgene NaOH → Lauryl Chloroformate NaCl CO2 H2O
Safety Information:
1. Lauryl chloroform is irritating. Contact with skin and eyes can cause irritation and burns. Please use personal protective equipment such as protective gloves and goggles.
2. When using Lauryl Chloroformate, please ensure that the operation is carried out in a well-ventilated place and avoid inhaling its vapor.
3. Lauryl chloroform should be stored in a sealed container, away from fire and oxidant, and avoid contact with air.
4. If Lauryl Chloroformate is swallowed or inhaled, seek medical attention immediately.
Nature:
1. Appearance: Lauryl chloroform is a colorless to pale yellow liquid.
2. Solubility: It is soluble in organic solvents such as ethanol and dimethylformamide, but insoluble in water.
3. Odor: a pungent smell.
Use:
1. Lauryl chloroform is a commonly used chemical reagent, which can be used as an acylation reagent in organic synthesis, for esterification reaction and preparation of ester compounds.
2. In organic synthesis, it can be used to synthesize surfactants, lubricants and dye intermediates.
3. Lauryl chloroform can also be used as a crosslinking agent in the polymer industry to increase the mechanical properties and thermal stability of the polymer.
Method:
Lauryl Chloroformate can be synthesized:
Lauryl Alcohol Phosgene NaOH → Lauryl Chloroformate NaCl CO2 H2O
Safety Information:
1. Lauryl chloroform is irritating. Contact with skin and eyes can cause irritation and burns. Please use personal protective equipment such as protective gloves and goggles.
2. When using Lauryl Chloroformate, please ensure that the operation is carried out in a well-ventilated place and avoid inhaling its vapor.
3. Lauryl chloroform should be stored in a sealed container, away from fire and oxidant, and avoid contact with air.
4. If Lauryl Chloroformate is swallowed or inhaled, seek medical attention immediately.
Last Update：2024-04-10 22:29:15
