M-cymene
M-cymene
CAS: 535-77-3
Molecular Formula: C10H14
M-cymene - Names and Identifiers
| Name | M-cymene |
| Synonyms | m-Cymol M-cymene beta-Cymene 3-methyl-1-isopropylbenzene 1-methyl-3-(1-methylethyl)-benzen 1-methyl-3-(1-methylethyl)benzene 1-Methyl-3-(1-methylethyl)-benzene benzene,1-methyl-3-(1-methylethyl)- Benzene, 1-methyl-3-(1-methylethyl)- |
| CAS | 535-77-3 |
| EINECS | 208-617-9 |
| InChI | InChI=1/C10H14/c1-8(2)10-6-4-5-9(3)7-10/h4-8H,1-3H3 |
M-cymene - Physico-chemical Properties
| Molecular Formula | C10H14 |
| Molar Mass | 134.22 |
| Density | 0.861g/mLat 25°C(lit.) |
| Melting Point | −64°C(lit.) |
| Boling Point | 175°C(lit.) |
| Flash Point | 47 °C |
| Solubility | alcohol: miscible(lit.) |
| Vapor Presure | 4 mm Hg ( 37.7 °C) |
| Appearance | neat |
| Color | Colorless to Almost colorless |
| Merck | 14,2763 |
| BRN | 1851357 |
| Refractive Index | n20/D 1.492(lit.) |
M-cymene - Risk and Safety
| Risk Codes | 10 - Flammable |
| UN IDs | UN 2046 3/PG 3 |
| WGK Germany | 2 |
| RTECS | DA6127310 |
| Hazard Class | 3.2 |
| Packing Group | III |
M-cymene - Reference Information
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |
| category | flammable liquid |
| toxicity classification | poisoning |
| acute toxicity | oral-rat LD50: 2970 mg/kg; Oral-mouse LD50: 3272 mg/kg |
| flammability hazard characteristics | it is more flammable when exposed to open flames, high temperatures, and oxidants; steam is irritating; combustion produces stimulating smoke |
| storage and transportation characteristics | warehouse ventilation and low temperature drying; separate from oxidant |
| fire extinguishing agent | dry powder, dry sand, carbon dioxide, foam, 1211 fire extinguishing agent |
| toxic substance data | information provided by: pubchem.ncbi.nlm.nih.gov (external link) |
Last Update：2024-04-09 20:52:54
