N,N-bis(prop-2-enyl)carbamoyl chloride
diallylcarbamyl chloride
CAS: 25761-72-2
Molecular Formula: C7H10ClNO
N,N-bis(prop-2-enyl)carbamoyl chloride - Names and Identifiers
| Name | diallylcarbamyl chloride |
| Synonyms | diallylcarbamyl chloride DIALLYLCARBAMYL CHLORIDE Diallylcarbamic chloride diprop-2-en-1-ylcarbamic chloride N,N-bis(prop-2-enyl)carbamoyl chloride Carbamic chloride, N,N-di-2-propen-1-yl- |
| CAS | 25761-72-2 |
| InChI | InChI=1/C7H10ClNO/c1-3-5-9(6-4-2)7(8)10/h3-4H,1-2,5-6H2 |
N,N-bis(prop-2-enyl)carbamoyl chloride - Physico-chemical Properties
| Molecular Formula | C7H10ClNO |
| Molar Mass | 159.61 |
| Density | 1.069g/mLat 25°C(lit.) |
| Boling Point | 214-220°C(lit.) |
| Flash Point | 86°C |
| Vapor Presure | 0.0862mmHg at 25°C |
| Storage Condition | 2-8℃ |
| Refractive Index | n20/D 1.48(lit.) |
N,N-bis(prop-2-enyl)carbamoyl chloride - Risk and Safety
| Hazard Symbols | C - Corrosive |
| Risk Codes | 34 - Causes burns |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S27 - Take off immediately all contaminated clothing. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. S45 - In case of accident or if you feel unwell, seek medical advice immediately (show the label whenever possible.) |
| UN IDs | UN 1760 8/PG 3 |
| WGK Germany | 3 |
N,N-bis(prop-2-enyl)carbamoyl chloride - Introduction
diallylcarbamyl chloride, also known as diallylcarbamoyl chloride or diallylchloroformamide, chemical formula C9H12ClNO, is an organic compound.
its nature:
1. Appearance: colorless or light yellow liquid.
2. Odor: a pungent smell.
3. Solubility: Soluble in most organic solvents, such as alcohol, ether, etc.
4. Stability: relatively stable at room temperature, but can be decomposed to produce toxic gases.
Use:
1. diallylcarbamyl chloride can be used as an important intermediate in chemical synthesis and used in the synthesis of various organic compounds.
2. It is often used in polymer modification to increase flexibility and heat resistance.
3. Can be used in the field of water treatment, as a scale inhibitor and antibacterial agent.
4. Can also be used for surfactants, dyes, fungicides and other industries.
Method:
diallylcarbamyl chloride is often prepared by acylation with diallylamine and chloroformic acid in ethanol.
Safety Information:
1. diallylcarbamyl chloride is irritating and should be rinsed with plenty of water immediately after contact with skin and eyes.
2. May be toxic to vertebrates and aquatic organisms and should be avoided from entering water and soil.
3. Please wear protective gloves, goggles and protective clothing during use.
4. Avoid contact with oxidants or strong acids during storage to avoid dangerous reactions.
5. For accidental leakage, corresponding safety measures should be taken quickly to prevent proliferation and environmental pollution, and properly disposed. Consult the relevant safety data sheet before operation.
its nature:
1. Appearance: colorless or light yellow liquid.
2. Odor: a pungent smell.
3. Solubility: Soluble in most organic solvents, such as alcohol, ether, etc.
4. Stability: relatively stable at room temperature, but can be decomposed to produce toxic gases.
Use:
1. diallylcarbamyl chloride can be used as an important intermediate in chemical synthesis and used in the synthesis of various organic compounds.
2. It is often used in polymer modification to increase flexibility and heat resistance.
3. Can be used in the field of water treatment, as a scale inhibitor and antibacterial agent.
4. Can also be used for surfactants, dyes, fungicides and other industries.
Method:
diallylcarbamyl chloride is often prepared by acylation with diallylamine and chloroformic acid in ethanol.
Safety Information:
1. diallylcarbamyl chloride is irritating and should be rinsed with plenty of water immediately after contact with skin and eyes.
2. May be toxic to vertebrates and aquatic organisms and should be avoided from entering water and soil.
3. Please wear protective gloves, goggles and protective clothing during use.
4. Avoid contact with oxidants or strong acids during storage to avoid dangerous reactions.
5. For accidental leakage, corresponding safety measures should be taken quickly to prevent proliferation and environmental pollution, and properly disposed. Consult the relevant safety data sheet before operation.
Last Update：2024-04-10 22:29:15
Supplier List
Product Name: DIALLYLCARBAMYL CHLORIDE Visit Supplier Webpage Request for quotation
CAS: 25761-72-2
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 25761-72-2
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
Product Name: DIALLYLCARBAMYL CHLORIDE Visit Supplier Webpage Request for quotation
CAS: 25761-72-2
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 25761-72-2
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
View History