P-Nitrobenzyl chloride
4-Nitrobenzyl chloride
CAS: 100-14-1
Molecular Formula: C7H6ClNO2
P-Nitrobenzyl chloride - Names and Identifiers
| Name | 4-Nitrobenzyl chloride |
| Synonyms | P-Nitrobenzyl chloride 4-Nitrobenzyl chloride p-Nitrobenzyl chloride a-Chloro-4-nitrotoluene alpha-Chloro-4-nitrotoluene 1-(chloromethyl)-3-nitrobenzene 1-(chloromethyl)-4-nitrobenzene |
| CAS | 100-14-1 |
| EINECS | 202-822-7 |
| InChI | InChI=1/C7H6ClNO2/c8-5-6-2-1-3-7(4-6)9(10)11/h1-4H,5H2 |
P-Nitrobenzyl chloride - Physico-chemical Properties
| Molecular Formula | C7H6ClNO2 |
| Molar Mass | 171.581 |
| Density | 1.33g/cm3 |
| Melting Point | 71-74℃ |
| Boling Point | 230.5°C at 760 mmHg |
| Flash Point | 128.7°C |
| Vapor Presure | 0.0995mmHg at 25°C |
| Refractive Index | 1.574 |
| Physical and Chemical Properties | Melting point 71-74°C boiling point 112°C (0.6 torr) |
| Use | Used as a pharmaceutical Intermediate |
P-Nitrobenzyl chloride - Risk and Safety
| Hazard Symbols | C - Corrosive |
| Risk Codes | R22 - Harmful if swallowed R34 - Causes burns |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. S45 - In case of accident or if you feel unwell, seek medical advice immediately (show the label whenever possible.) |
P-Nitrobenzyl chloride - Introduction
Benzyl nitrochloride is an organic compound with the chemical formula C7H6ClNO2. Its nature is as follows:
1. solubility: can be dissolved in ether, ethanol and benzene and other organic solvents, insoluble in water.
2. melting point: the melting point of benzyl chloride is about 47-50 degrees Celsius.
The main uses of nitrobenzyl chloride are as follows:
1. It can be used as a starting material for organic synthesis, such as dyes.
2. Used as an intermediate for fungicides and catalysts.
The preparation methods of nitrobenzyl chloride mainly include the following:
1. direct nitration method: the reaction of benzyl chloride with concentrated nitric acid to generate nitrobenzyl chloride.
2. Naphthol method: Naphthol reacts with nitric acid to generate nitronaphthalene, and then chlorination reaction to obtain nitrobenzyl chloride.
regarding the safety information of nitrochlorobenzyl, the following points should be paid attention:
1. Nitrochlorobenzyl is irritating, and contact with skin and eyes may cause inflammation and irritation. Wear appropriate protective gloves and goggles when using.
2. in the use or storage of benzyl chloride, to avoid contact with strong oxidants, acids and bases and other substances, so as to avoid dangerous chemical reactions.
3. if the inhalation of nitrochlorobenzyl dust or steam, should immediately away from the contaminated area, to a well-ventilated place to breathe fresh air, and timely medical treatment.
Please note that when using nitrochlorobenzyl, follow the relevant safety procedures and follow the safety technical instructions provided by the manufacturer.
Last Update：2024-04-09 19:55:45