| Name | O,O-diethyl-O-(2-chloro-4-bromophenyl)thiophosphate |
| Synonyms | O,O-diethyl-O-(2-chloro-4-bromophenyl)thiophosphate Phosphorothioic acid, O-(4-bromo-2-chlorophenyl) O,O-diethyl ester |
| CAS | 60731-55-7 |
| Molecular Formula | C10H13BrClO3PS |
| Molar Mass | 359.6 |
| Use | Uses O,O diethyl O-(2-chloro-4-bromophenyl) phosphorothioate, short for triester, is an intermediate of the asymmetric organophosphorus insecticide propylphosphonium bromide. |
| Raw Materials | Diethyl chlorothiophosphate 4-Bromo-2-chlorophenol |
The preparation method is to react sodium 2-chloro-4-bromophenol with ethyl chloride to synthesize O,O-diethyl-O-(2-chloro-4-bromophenyl) thiophosphate.
Put the quantitative 2-chloro-4-bromophenol sodium solution into a 2000L reaction kettle, start stirring, put the quantitative ethyl chloride into the reaction kettle, control the reaction temperature below 30 ℃, slowly add the required catalyst dropwise, continue the reaction for a certain period of time after addition, and control the pH value of the reaction end point to be alkaline. After the reaction, a certain amount of water is added, the lower liquid is put into the reaction kettle, washed and stirred for 2 hours, and then pumped to the stratification tank to stand and stratify, and the lower liquid is the intermediate product triester.
The triester is a colorless liquid, insoluble in water.