Posaconazole impurity NPPY
4-(4-(4-Nitrophenyl)-1-piperazinyl)phenol
CAS: 112559-81-6
Molecular Formula: C16H17N3O3
Posaconazole impurity NPPY - Names and Identifiers
| Name | 4-(4-(4-Nitrophenyl)-1-piperazinyl)phenol |
| Synonyms | Posaconazole impurity NPPY 4-[4-(4-nitrophenyl)piperazin-1-yl]phenol 4-(4-(4-Nitrophenyl)-1-piperazinyl)phenol 4-(4-(4-nitrophenyl)piperazin-1-yl)phenol 4-[4-(4-hydroxyphenyl)-1-piperazinyl]phenol Phenol, 4-[4-(4-nitrophenyl)-1-piperazinyl]- 1-(4-Nitrophenyl)-4-(4-hydroxyphenyl)piperazine 1-(4-HYDROXYPHENYL)-4-(4-NITROPHENYL)-PIPERAZINE 4-(4-(4-Nitrophenyl)-1-piperazinyl)phenol Itraconazole interMediate |
| CAS | 112559-81-6 |
| EINECS | 601-189-8 |
| InChI | InChI=1/C16H17N3O3/c20-16-7-5-14(6-8-16)18-11-9-17(10-12-18)13-1-3-15(4-2-13)19(21)22/h1-8,20H,9-12H2 |
Posaconazole impurity NPPY - Physico-chemical Properties
| Molecular Formula | C16H17N3O3 |
| Molar Mass | 299.32 |
| Density | 1.317±0.06 g/cm3(Predicted) |
| Melting Point | >90°C (dec.) |
| Boling Point | 540.8±50.0 °C(Predicted) |
| Flash Point | 280.9°C |
| Solubility | DMSO (Slightly, Heated) |
| Vapor Presure | 2.61E-12mmHg at 25°C |
| Appearance | Solid |
| Color | Yellow to Brown |
| pKa | 12.18±0.30(Predicted) |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.65 |
Posaconazole impurity NPPY - Introduction
4-(4-(4-nitrophenyl)-1-piperazinyl) phenol, also known as 1-(4-phenolyl)-4-(4-nitrophenyl) piperidine, is an organic compound. It has the following properties:
1. Appearance: White crystalline solid.
2. solubility: soluble in organic solvents, such as ethanol, dimethylformamide.
3. Thermal stability: stable at high temperature, can be heated to 150°C under basically unchanged conditions.
4. Chemical reaction: It is an organic fluorescent dye that can emit orange-red fluorescence under ultraviolet excitation.
This compound has several applications in the laboratory and industry:
1. Dye: Due to its fluorescent properties, it can be used as a dye pigment for dyeing and marking.
2. Chemical indicator: It can be used as a redox indicator, for example, to detect reducing agents in chemical reactions.
3. optical materials: can be used to prepare optical sensors and optical materials.
4. pharmaceutical field: due to its special structure, it can be used to synthesize drug intermediates.
The preparation method of this compound is complicated and is usually synthesized using organic synthesis methods. The specific preparation method can refer to the relevant organic chemistry literature and patents.
Regarding safety information, necessary safety measures need to be taken for the operation and use of any chemical substance. This compound has some potential safety risks, including irritation and toxicity. When using, please carefully read the safety information provided by the relevant chemicals, and take correct operation and protective measures according to their use requirements. At the same time, please follow the correct handling and storage methods of chemicals to ensure safe use. If necessary, consult your chemical professional or relevant body for more detailed safety information.
1. Appearance: White crystalline solid.
2. solubility: soluble in organic solvents, such as ethanol, dimethylformamide.
3. Thermal stability: stable at high temperature, can be heated to 150°C under basically unchanged conditions.
4. Chemical reaction: It is an organic fluorescent dye that can emit orange-red fluorescence under ultraviolet excitation.
This compound has several applications in the laboratory and industry:
1. Dye: Due to its fluorescent properties, it can be used as a dye pigment for dyeing and marking.
2. Chemical indicator: It can be used as a redox indicator, for example, to detect reducing agents in chemical reactions.
3. optical materials: can be used to prepare optical sensors and optical materials.
4. pharmaceutical field: due to its special structure, it can be used to synthesize drug intermediates.
The preparation method of this compound is complicated and is usually synthesized using organic synthesis methods. The specific preparation method can refer to the relevant organic chemistry literature and patents.
Regarding safety information, necessary safety measures need to be taken for the operation and use of any chemical substance. This compound has some potential safety risks, including irritation and toxicity. When using, please carefully read the safety information provided by the relevant chemicals, and take correct operation and protective measures according to their use requirements. At the same time, please follow the correct handling and storage methods of chemicals to ensure safe use. If necessary, consult your chemical professional or relevant body for more detailed safety information.
Last Update：2024-04-09 21:11:58
Supplier List
Spot supply
Product Name: Posaconazole Impurity 56 Visit Supplier Webpage Request for quotationCAS: 112559-81-6
Tel: 0714-3999186
Email: 2853786052@qq.com
Mobile: 86+15671228036
QQ: 2853786052
Wechat: 15671228036
Product Name: 4-(4-(4-Nitrophenyl)-1-piperazinyl)phenol Visit Supplier Webpage Request for quotation
CAS: 112559-81-6
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 112559-81-6
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
Spot supply
Product Name: Posaconazole Impurity 56 Visit Supplier Webpage Request for quotationCAS: 112559-81-6
Tel: 0714-3999186
Email: 2853786052@qq.com
Mobile: 86+15671228036
QQ: 2853786052
Wechat: 15671228036
Product Name: 4-(4-(4-Nitrophenyl)-1-piperazinyl)phenol Visit Supplier Webpage Request for quotation
CAS: 112559-81-6
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 112559-81-6
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
View History