Pyridoxylidene-L-glutamic Acid Dipotassium Salt
Pyridoxylideneglutamicaciddipotassiumsalt
CAS: 13934-03-7
Molecular Formula: C13H16N2O6
Pyridoxylidene-L-glutamic Acid Dipotassium Salt - Names and Identifiers
| Name | Pyridoxylideneglutamicaciddipotassiumsalt |
| Synonyms | pyridoxylideneglutamate Pyridoxylideneglutamicaciddipotassiumsalt Pyridoxylidene-L-glutamic Acid Dipotassium Salt PYRIDOXYLIDENE-L-GLUTAMIC ACID DIPOTASSIUM SALT Pyridoxylidene-L-glutamic acid dipotassium salt Pyridoxylidene-smallLsmall-glutamicAcidDipotassiumSal N-{(E)-[5-(hydroxymethyl)-2-methyl-3-oxopyridin-4(3H)-ylidene]methyl}-L-glutamic acid (S)-2-(((3-Hydroxy-5-(hydroxymethyl)-2-methylpyridin-4-yl)methylene)amino)pentanedioic acid N-[[3-Hydroxy-5-(hydroxymethyl)-2-methyl-4-pyridyl]methylene]-L-glutamic acid dipotassium salt |
| CAS | 13934-03-7 |
| InChI | InChI=1/C13H16N2O6.2K/c1-7-12(19)9(8(6-16)4-14-7)5-15-10(13(20)21)2-3-11(17)18;;/h4-5,10,16,19H,2-3,6H2,1H3,(H,17,18)(H,20,21);;/q;2*+1/p-2/b15-5+;;/t10-;;/m0../s1 |
Pyridoxylidene-L-glutamic Acid Dipotassium Salt - Physico-chemical Properties
| Molecular Formula | C13H16N2O6 |
| Molar Mass | 296.28 |
| Storage Condition | Room Temprature |
| MDL | MFCD06809726 |
Pyridoxylidene-L-glutamic Acid Dipotassium Salt - Introduction
Pyridoxal-L-glutamic acid dipotassium salt is an organic compound, also known as monosodium glutamate potassium disalt. Its chemical formula is C10H17N2O10K2.
Nature:
1. Appearance: Pyridoxal-L-glutamic acid dipotassium salt is colorless or white crystalline powder.
2. solubility: it is easy to dissolve in water, resulting in a neutral solution. It is also soluble in alcohol and other organic solvents.
Use:
1. Food additives: Pyridoxal-L-glutamic acid dipotassium salt is a common flavor enhancer, which is widely used in food and condiments to enhance the umami taste of food.
2. Pharmaceutical field: It is also used to prepare certain drugs, such as oral solutions and parenteral nutrition.
Preparation Method:
Pyridoxal-L-glutamic acid dipotassium salt can be prepared by reacting L-glutamic acid with pyrrolidone under alkaline conditions. An appropriate amount of potassium chloride is added during the reaction to form a dipotassium salt with L-glutamic acid.
Safety Information:
Pyridoxal-L-glutamic acid dipotassium salt is safe under recommended use, but the following matters should be noted:
1. pay attention to moderate use, excessive intake may lead to discomfort or allergic reactions.
2. For people with special diseases or allergies to certain additives, it is recommended to consult a doctor or dietitian before use.
3. Store to avoid direct sunlight and humid environment to ensure its quality and stability.
4. Please read the instructions and precautions on the product label carefully when using.
Nature:
1. Appearance: Pyridoxal-L-glutamic acid dipotassium salt is colorless or white crystalline powder.
2. solubility: it is easy to dissolve in water, resulting in a neutral solution. It is also soluble in alcohol and other organic solvents.
Use:
1. Food additives: Pyridoxal-L-glutamic acid dipotassium salt is a common flavor enhancer, which is widely used in food and condiments to enhance the umami taste of food.
2. Pharmaceutical field: It is also used to prepare certain drugs, such as oral solutions and parenteral nutrition.
Preparation Method:
Pyridoxal-L-glutamic acid dipotassium salt can be prepared by reacting L-glutamic acid with pyrrolidone under alkaline conditions. An appropriate amount of potassium chloride is added during the reaction to form a dipotassium salt with L-glutamic acid.
Safety Information:
Pyridoxal-L-glutamic acid dipotassium salt is safe under recommended use, but the following matters should be noted:
1. pay attention to moderate use, excessive intake may lead to discomfort or allergic reactions.
2. For people with special diseases or allergies to certain additives, it is recommended to consult a doctor or dietitian before use.
3. Store to avoid direct sunlight and humid environment to ensure its quality and stability.
4. Please read the instructions and precautions on the product label carefully when using.
Last Update：2024-04-09 15:17:52
