RARECHEM AL BI 0250
2-benzyl-2-methyl-1,3-dioxolane
CAS: 4362-18-9;5432-17-7
Molecular Formula: C11H14O3
RARECHEM AL BI 0250 - Names and Identifiers
| Name | 2-benzyl-2-methyl-1,3-dioxolane |
| Synonyms | Nsc7016 RARECHEM AL BI 0250 ETHYL-3-ETHOXYBENZOATE ethyl 3-ethoxybenzoate ETHYL M-ETHOXYBENZOATE 2-benzyl-2-methyl-1,3-dioxolane 1,3-Dioxolane, 2-benzyl-2-methyl- 1-Phenyl-2-propanone ethylene acetal Benzoic acid, 3-ethoxy-, ethyl ester 1,3-Dioxolane, 2-methyl-2-(phenylmethyl)- |
| CAS | 4362-18-9 5432-17-7 |
| InChI | InChI=1/C11H14O3/c1-3-13-10-7-5-6-9(8-10)11(12)14-4-2/h5-8H,3-4H2,1-2H3 |
RARECHEM AL BI 0250 - Physico-chemical Properties
| Molecular Formula | C11H14O3 |
| Molar Mass | 194.23 |
| Density | 1.06g/mLat 25°C(lit.) |
| Boling Point | 152°C35mm Hg(lit.) |
| Flash Point | >230°F |
| Vapor Presure | 0.00996mmHg at 25°C |
| Specific Gravity | 1.06 |
| Refractive Index | n20/D 1.508(lit.) |
RARECHEM AL BI 0250 - Risk and Safety
| Hazard Symbols | Xi - Irritant |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S23 - Do not breathe vapour. S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| WGK Germany | 3 |
RARECHEM AL BI 0250 - Introduction
2-benzene -2-methyl-1,3-dioxolane(2-benzene -2-methyl-1,3-dioxolane) is an organic compound with the following properties:
1. appearance: colorless or light yellow liquid.
2. Solubility: Soluble in many organic solvents, such as ethanol, ether and acetone.
3. melting point and boiling point: no clear data.
4. density: about 1.0 g/cm.
The main uses of 2-benzyl-2-methyl-1,3-dioxolane are as follows:
1. Chemical synthesis: It is an important synthetic intermediate that can be used to synthesize biologically active compounds, such as drugs or pesticides.
2. spices: it has a fragrant smell, is used as a perfume, soap and cosmetics products such as ingredients.
the preparation method of 2-benzyl-2-methyl-1,3-dioxolane generally adopts the following steps:
1. epoxidation reaction: styrene is reacted with hydrogen peroxide to generate 2-phenyl -2-propanol.
2. Condensation reaction: 2-phenyl -2-propanol reacts with formaldehyde to generate 1-phenyl -2-propanol acetal.
3. cyclization reaction: 1-phenyl -2-propanol acetal is reacted with an acid to generate the final product 2-benzyl-2-methyl-1,3-dioxolane.
Regarding safety information, 2-benzyl-2-methyl-1,3-dioxolane is a chemical, and the following matters need to be noted:
1. Toxicity: This compound is potentially toxic and may cause irritation and harm to the human body. Therefore, appropriate safety measures should be taken during use, such as wearing protective gloves, goggles and protective clothing.
2. Combustibility: It is a flammable compound, avoid contact with open flame, high temperature and oxidant.
3. storage and handling: store it in a dry, well-ventilated place, and away from fire and flammable materials. When disposing of waste, it should be disposed of in accordance with local regulations.
4. Poisoning events: such as accidental inhalation or contact, you should immediately move to a well-ventilated place and seek medical help.
In general, when using 2-benzyl-2-methyl-1,3-dioxolane, appropriate protective measures must be taken to ensure safety and avoid potential hazards. The safety data sheet to which the compound relates should be read and observed prior to specific operations.
1. appearance: colorless or light yellow liquid.
2. Solubility: Soluble in many organic solvents, such as ethanol, ether and acetone.
3. melting point and boiling point: no clear data.
4. density: about 1.0 g/cm.
The main uses of 2-benzyl-2-methyl-1,3-dioxolane are as follows:
1. Chemical synthesis: It is an important synthetic intermediate that can be used to synthesize biologically active compounds, such as drugs or pesticides.
2. spices: it has a fragrant smell, is used as a perfume, soap and cosmetics products such as ingredients.
the preparation method of 2-benzyl-2-methyl-1,3-dioxolane generally adopts the following steps:
1. epoxidation reaction: styrene is reacted with hydrogen peroxide to generate 2-phenyl -2-propanol.
2. Condensation reaction: 2-phenyl -2-propanol reacts with formaldehyde to generate 1-phenyl -2-propanol acetal.
3. cyclization reaction: 1-phenyl -2-propanol acetal is reacted with an acid to generate the final product 2-benzyl-2-methyl-1,3-dioxolane.
Regarding safety information, 2-benzyl-2-methyl-1,3-dioxolane is a chemical, and the following matters need to be noted:
1. Toxicity: This compound is potentially toxic and may cause irritation and harm to the human body. Therefore, appropriate safety measures should be taken during use, such as wearing protective gloves, goggles and protective clothing.
2. Combustibility: It is a flammable compound, avoid contact with open flame, high temperature and oxidant.
3. storage and handling: store it in a dry, well-ventilated place, and away from fire and flammable materials. When disposing of waste, it should be disposed of in accordance with local regulations.
4. Poisoning events: such as accidental inhalation or contact, you should immediately move to a well-ventilated place and seek medical help.
In general, when using 2-benzyl-2-methyl-1,3-dioxolane, appropriate protective measures must be taken to ensure safety and avoid potential hazards. The safety data sheet to which the compound relates should be read and observed prior to specific operations.
Last Update：2024-04-09 21:32:41
