RARECHEM AL BO 0509 - Names and Identifiers
Name | 2,3,6-(trifluorophenyl)acetic acid
|
Synonyms | RARECHEM AL BO 0509 2,3,6-Trifluorophenylaceitc acid 2,3,6-TRIFLUOROPHENYLACETIC ACID 2,3,6-Trifluorophenylacetic acid 2,3,6-(trifluorophenyl)acetic acid Benzeneacetic acid,2,3,6-trifluoro- 2-(2,3,6-trifluorophenyl)acetic acid (2,3,6-Trifluorophenyl)acetic acid, 2-(2,3,6-Trifluorophenyl)ethanoic acid
|
CAS | 114152-23-7
|
InChI | InChI=1/C8H5F3O2/c9-5-1-2-6(10)8(11)4(5)3-7(12)13/h1-2H,3H2,(H,12,13) |
RARECHEM AL BO 0509 - Physico-chemical Properties
Molecular Formula | C8H5F3O2
|
Molar Mass | 190.12 |
Density | 1.468±0.06 g/cm3(Predicted) |
Melting Point | 111-114°C(lit.) |
Boling Point | 249.5±35.0 °C(Predicted) |
Flash Point | 104.7°C |
Vapor Presure | 0.012mmHg at 25°C |
Appearance | White powder or crystal |
Color | White to slightly yellow |
pKa | 3.53±0.10(Predicted) |
Storage Condition | Sealed in dry,Room Temperature |
Refractive Index | 1.488 |
MDL | MFCD00061217 |
RARECHEM AL BO 0509 - Risk and Safety
Hazard Symbols | Xi - Irritant

|
Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin.
|
Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.
S36 - Wear suitable protective clothing.
|
WGK Germany | 3 |
HS Code | 29163900 |
Hazard Class | IRRITANT |
RARECHEM AL BO 0509 - Introduction
2,3, 6-Trifluorophenylacetic acid is an organic compound with the chemical formula C8H5F3O2, often abbreviated as TFBA. The following is a description of its nature, use, preparation and safety information:
Nature:
1. Appearance: Colorless or yellow crystalline solid.
2. melting point: about 50-53 degrees Celsius.
3. Boiling point: about 200-205 degrees Celsius.
4. density: about 1.474 g/cm.
5. Solubility: Soluble in organic solvents such as ethanol, dimethyl sulfoxide, insoluble in water.
6. Reactivity: sensitive to light, heat and oxygen, can occur substitution reaction, esterification reaction, etc.
Use:
1. As a drug intermediate: TFBA can be used to synthesize a variety of drugs, such as chemotherapeutic agents, anti-cancer drugs, etc.
2. As a dye intermediate: TFBA can be used to synthesize aromatic amide dyes with good dyeing properties.
3. for organic synthesis: TFBA can be used as a reagent and catalyst in organic synthesis, and participate in various organic synthesis reactions.
Method:
the common preparation method of TFBA is prepared by the substitution reaction of trifluoromethylbenzene. A common preparation method is to react trifluoromethylbenzene with bromoacetic acid under basic conditions to give 2,3, 6-trifluorophenylacetic acid.
Safety Information:
1. TFBA is less harmful to human body and environment, but it is still necessary to follow the correct safe operation method.
2. During use, avoid contact with skin, eyes and respiratory tract, and avoid inhaling dust or gas.
3. During operation, wear appropriate protective equipment, such as gloves, glasses and protective masks.
4. storage should be placed in a cool, dry and well ventilated place, away from fire and oxidant.
Please note that the relevant information of TFBA is for reference only. The specific operation and use should follow the laboratory safety regulations and chemical safety operation guidelines.
Last Update:2024-04-09 15:17:51