Silane, tris(1-methylethoxy)-
tris(propan-2-yloxy)silane
CAS: 6675-79-2
Molecular Formula: C9H22O3Si
Silane, tris(1-methylethoxy)- - Names and Identifiers
| Name | tris(propan-2-yloxy)silane |
| Synonyms | TRIISOPROPOXYSILANE tri(propan-2-yloxy)silicon tris(propan-2-yloxy)silane Silane, tris(1-methylethoxy)- |
| CAS | 6675-79-2 |
| InChI | InChI=1/C9H22O3Si/c1-7(2)10-13(11-8(3)4)12-9(5)6/h7-9,13H,1-6H3 |
Silane, tris(1-methylethoxy)- - Physico-chemical Properties
| Molecular Formula | C9H22O3Si |
| Molar Mass | 206.35 |
| Density | 0.8565 g/cm3 |
| Melting Point | <0°C |
| Boling Point | 35°C 5mm |
| Flash Point | <60°C |
| Vapor Presure | 1.237mmHg at 25°C |
| Specific Gravity | 0.854 |
| Storage Condition | under inert gas (nitrogen or Argon) at 2–8 °C |
| Sensitive | 7: reacts slowly with moisture/water |
| Refractive Index | 1.3839 |
Silane, tris(1-methylethoxy)- - Risk and Safety
| Risk Codes | 10 - Flammable |
| Safety Description | 16 - Keep away from sources of ignition. |
| UN IDs | 1993 |
| TSCA | No |
Silane, tris(1-methylethoxy)- - Introduction
tris(propan-2-yloxy)silane is an organosilicon compound with the chemical formula (Si(OCH(CH3)2)3). The following is an introduction to some of its properties, uses, methods and safety information:
Nature:
1. Appearance: colorless liquid
2. molecular weight: 222.43g/mol
3. melting point:-86 ℃
4. Boiling point: 168 ℃
5. density: 0.938 g/cm
6. Solubility: Soluble in ethanol, ethers and organic solvents, slightly soluble in water.
Use:
1. tris(propan-2-yloxy)silane is a commonly used silicon reagent in organic synthesis. It is commonly used in organic synthesis reactions as a silicon chain extender for the synthesis of silicon-containing organic compounds.
2. It can also be used as a raw material for surfactants and lubricants to improve the performance of coatings, plastics and rubbers.
3. In addition, it is also used to prepare polyamide resins and silica gel materials containing hydrophilic groups.
Preparation Method:
tris(propan-2-yloxy)silane is generally prepared by reacting trichloromethylsilane with isopropanol (2-propanol). The specific preparation steps are as follows:
1. Under inert gas, slowly add trichloromethylsilane dropwise to isopropanol.
2. The reaction temperature is generally between room temperature and 60 ℃, and the appropriate time is selected according to the reaction conditions.
3. After the reaction, the target product is obtained by distillation, decompression or extraction.
Safety Information:
1. tris(propan-2-yloxy)silane may be irritating and should avoid contact with skin and eyes.
2. when in use should wear appropriate protective gloves, protective glasses and work clothes.
3. If inhaled or ingested, seek medical attention immediately.
4. storage should be sealed, away from the fire and easy to burn substances.
5. before use should read and follow the product safety technical instructions and operating guidelines.
It should be noted that the above information is for reference only, please process and operate according to the actual situation in the specific application.
Nature:
1. Appearance: colorless liquid
2. molecular weight: 222.43g/mol
3. melting point:-86 ℃
4. Boiling point: 168 ℃
5. density: 0.938 g/cm
6. Solubility: Soluble in ethanol, ethers and organic solvents, slightly soluble in water.
Use:
1. tris(propan-2-yloxy)silane is a commonly used silicon reagent in organic synthesis. It is commonly used in organic synthesis reactions as a silicon chain extender for the synthesis of silicon-containing organic compounds.
2. It can also be used as a raw material for surfactants and lubricants to improve the performance of coatings, plastics and rubbers.
3. In addition, it is also used to prepare polyamide resins and silica gel materials containing hydrophilic groups.
Preparation Method:
tris(propan-2-yloxy)silane is generally prepared by reacting trichloromethylsilane with isopropanol (2-propanol). The specific preparation steps are as follows:
1. Under inert gas, slowly add trichloromethylsilane dropwise to isopropanol.
2. The reaction temperature is generally between room temperature and 60 ℃, and the appropriate time is selected according to the reaction conditions.
3. After the reaction, the target product is obtained by distillation, decompression or extraction.
Safety Information:
1. tris(propan-2-yloxy)silane may be irritating and should avoid contact with skin and eyes.
2. when in use should wear appropriate protective gloves, protective glasses and work clothes.
3. If inhaled or ingested, seek medical attention immediately.
4. storage should be sealed, away from the fire and easy to burn substances.
5. before use should read and follow the product safety technical instructions and operating guidelines.
It should be noted that the above information is for reference only, please process and operate according to the actual situation in the specific application.
Last Update：2024-04-10 22:29:15
Supplier List
Product Name: TRIISOPROPOXYSILANE Visit Supplier Webpage Request for quotation
CAS: 6675-79-2
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 6675-79-2
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
Product Name: TRIISOPROPOXYSILANE Visit Supplier Webpage Request for quotation
CAS: 6675-79-2
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 6675-79-2
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
View History