ethyl 3-(4-fluorophenyl)-1H-indole-2-carboxylate
ethyl 3-(4-fluorophenyl)-1H-indole-2-carboxylate
CAS: 93957-39-2
Molecular Formula: C17H14FNO2
ethyl 3-(4-fluorophenyl)-1H-indole-2-carboxylate - Names and Identifiers
| Name | ethyl 3-(4-fluorophenyl)-1H-indole-2-carboxylate |
| Synonyms | 3-(4'-fluorophenyl)indole-2-carboxylate ethyl 3-(4'-fluorophenyl)indole-2-carboxylate Ethyl 3-(4'-fluorophenyl)indole-2-carboxylate ethyl 3-(4-fluorophenyl)-1H-indole-2-carboxylate Ethyl 3-(4-fluorophenyl)-1H-indole-2-carboxylate 3-(4'-fluorophenyl)indole-2-carboxylic acid ethyl ester 1H-Indole-2-carboxylic acid, 3-(4-fluorophenyl)-, ethyl ester |
| CAS | 93957-39-2 |
| InChI | InChI=1/C17H14FNO2/c1-2-21-17(20)16-15(11-7-9-12(18)10-8-11)13-5-3-4-6-14(13)19-16/h3-10,19H,2H2,1H3 |
ethyl 3-(4-fluorophenyl)-1H-indole-2-carboxylate - Physico-chemical Properties
| Molecular Formula | C17H14FNO2 |
| Molar Mass | 283.3 |
| Density | 1.254g/cm3 |
| Melting Point | 131.5-132.0℃ |
| Boling Point | 474°C at 760 mmHg |
| Flash Point | 240.5°C |
| Vapor Presure | 3.75E-09mmHg at 25°C |
| Storage Condition | 2-8°C |
| Refractive Index | 1.622 |
ethyl 3-(4-fluorophenyl)-1H-indole-2-carboxylate - Introduction
Ethyl 3-(4-fluorophenyl)-1H-indole-2-carboxylate, chemical formula C17H14FNO2, is an organic compound. It has the following properties:
1. Appearance: ethyl 3-(4-fluorophenyl)-1H-indole-2-carboxylate is a white to pale yellow solid.
2. solubility: it can be dissolved in common organic solvents.
3. melting point: its melting point is about 78-80 ℃.
4. storage stability: should be stored in a cool, dry place, and avoid direct sunlight.
The primary use of ethyl 3-(4-fluorophenyl)-1H-indole-2-carboxylate is as a pharmaceutical intermediate. It is often used in the field of medicinal chemistry to synthesize drugs, such as anti-inflammatory drugs, anti-cancer drugs, etc.
The method for preparing ethyl 3-(4-fluorophenyl)-1H-indole-2-carboxylate is generally achieved by chemical synthesis reaction. The specific synthesis method may vary depending on the manufacturer and researcher, but generally includes the reaction and treatment of the corresponding starting material to obtain the target product.
For the safety information of ethyl 3-(4-fluorophenyl)-1H-indole-2-carboxylate, there is no specific relevant research paper or data, so there is a lack of detailed data. During use and handling, laboratory safety operating procedures should be followed, and corresponding personal protective measures should be taken, such as wearing gloves, goggles and laboratory coats to ensure safety. Before using this compound, it is recommended to refer to the relevant literature and the Chemical Safety Data Sheet (MSDS) for more information.
1. Appearance: ethyl 3-(4-fluorophenyl)-1H-indole-2-carboxylate is a white to pale yellow solid.
2. solubility: it can be dissolved in common organic solvents.
3. melting point: its melting point is about 78-80 ℃.
4. storage stability: should be stored in a cool, dry place, and avoid direct sunlight.
The primary use of ethyl 3-(4-fluorophenyl)-1H-indole-2-carboxylate is as a pharmaceutical intermediate. It is often used in the field of medicinal chemistry to synthesize drugs, such as anti-inflammatory drugs, anti-cancer drugs, etc.
The method for preparing ethyl 3-(4-fluorophenyl)-1H-indole-2-carboxylate is generally achieved by chemical synthesis reaction. The specific synthesis method may vary depending on the manufacturer and researcher, but generally includes the reaction and treatment of the corresponding starting material to obtain the target product.
For the safety information of ethyl 3-(4-fluorophenyl)-1H-indole-2-carboxylate, there is no specific relevant research paper or data, so there is a lack of detailed data. During use and handling, laboratory safety operating procedures should be followed, and corresponding personal protective measures should be taken, such as wearing gloves, goggles and laboratory coats to ensure safety. Before using this compound, it is recommended to refer to the relevant literature and the Chemical Safety Data Sheet (MSDS) for more information.
Last Update：2024-04-09 21:04:16
