Name | 2-chloro-1-(4-hydroxyphenyl)ethan-1-one |
Synonyms | Brn 2086326 BRN 2086326 Chlorophenacyle chlorophenacyle Einecs 228-613-0 p-(chloroacetyl)phenol p-(Chloroacetyl)phenol 4-hydroxyphenacylchloride p-Hydroxyphenacyl chloride 4-Hydroxyphenacyl chloride 2-Chloro-4'-hydroxyacetophenone Acetophenone, 2-chloro-4'-hydroxy- 2-Chloro-1-(4-hydroxyphenyl)ethanone 2-Chloro-1-(4-hydroxy-phenyl)ethanone 2-chloro-1-(4-hydroxyphenyl)ethan-1-one Ethanone, 2-chloro-1-(4-hydroxyphenyl)- 2-Chloro-1-(4-hydroxyphenyl)ethan-1-one 4-08-00-00349 (Beilstein Handbook Reference) |
CAS | 6305-04-0 |
EINECS | 228-613-0 |
InChI | InChI=1/C8H7ClO2/c9-5-8(11)6-1-3-7(10)4-2-6/h1-4,10H,5H2 |
Molecular Formula | C8H7ClO2 |
Molar Mass | 170.59 |
Density | 1.2315 (rough estimate) |
Melting Point | 145-146 °C |
Boling Point | 241.44°C (rough estimate) |
Flash Point | 157.7°C |
Vapor Presure | 5.48E-05mmHg at 25°C |
pKa | 7.72±0.15(Predicted) |
Storage Condition | 2-8℃ |
Refractive Index | 1.5100 (estimate) |
MDL | MFCD00229893 |
EPA chemical substance information | information provided by: ofmpeb.epa.gov (external link) |
Application | 2-chloro-4 '-hydroxyacetophenone can be used as an organic intermediate and a pharmaceutical intermediate, mainly used in laboratory research and development process and chemical production process. |