p-Xylene-d10, Isotopic
p-Xylene-d10
CAS: 41051-88-1
Molecular Formula: C8D10
p-Xylene-d10, Isotopic - Names and Identifiers
| Name | p-Xylene-d10 |
| Synonyms | p-Xylene-d10 P-XYLENE-D10 (2H10)-p-xylene (2H10)-p-Xylene p-Xylene-d10, Isotopic 1,4-Dimethylbenzene-d10 p-Xylene-d{10}, Isotopic 1,4-Di(methyl-d3)benzene-d4 1,4-bis[(2H3_)methyl](2H4_)benzene Benzene-1,2,4,5-d4,3,6-di(methyl-d3)- Benzene-1,2,4,5-d4-, 3,6-di(methyl-d3)- 1,2,4,5-tetradeuterio-3,6-bis(trideuteriomethyl)benzene |
| CAS | 41051-88-1 |
| EINECS | 255-193-6 |
| InChI | InChI=1/C8H10/c1-7-3-5-8(2)6-4-7/h3-6H,1-2H3/i1D3,2D3,3D,4D,5D,6D |
p-Xylene-d10, Isotopic - Physico-chemical Properties
| Molecular Formula | C8D10 |
| Molar Mass | 116.23 |
| Density | 0.948g/mLat 25°C(lit.) |
| Melting Point | 13 °C |
| Boling Point | 135°C(lit.) |
| Flash Point | 86°F |
| Water Solubility | Insoluble in water. |
| Solubility | 0.2g/l |
| Vapor Presure | 7.94mmHg at 25°C |
| Appearance | Morphological Liquid |
| Merck | 14,10081 |
| Storage Condition | Store below +30°C. |
| Sensitive | Moisture Sensitive |
| Explosive Limit | 1.1-7%(V) |
| Refractive Index | n20/D 1.492(lit.) |
p-Xylene-d10, Isotopic - Risk and Safety
| Hazard Symbols | Xn - Harmful |
| Risk Codes | R10 - Flammable R20/21 - Harmful by inhalation and in contact with skin. R38 - Irritating to the skin |
| Safety Description | S23 - Do not breathe vapour. S36/37 - Wear suitable protective clothing and gloves. |
| UN IDs | UN 1307 3/PG 3 |
| WGK Germany | 3 |
| HS Code | 28459000 |
| Hazard Class | 3 |
| Packing Group | III |
p-Xylene-d10, Isotopic - Upstream Downstream Industry
| Raw Materials | 2,6,9,10-Anthracenetetracarbonitrile P-XYLENE |
| Downstream Products | Pyrimidine TEREPHTHALIC-D4 ACID P-XYLENE-ALPHA,ALPHA,ALPHA,ALPHA',ALPHA',ALPHA'-D6 Pyrazine Pyridazine |
p-Xylene-d10, Isotopic - Introduction
p-Xylene-d10 (p-Xylene-d10) is a deuterated compound with a chemical formula of C6D5CD2CD3 and a molecular weight of 121.24g/mol. It is an isotope replacement product of p-xylene and is a colorless liquid.
p-Xylene-d10 has a wide range of applications in scientific research and industrial production. Here are some of its main properties and uses:
1. Important solvent: p-Xylene-d10 is a non-polar solvent that can be used to dissolve many organic substances, especially in mass spectrometry.
2. labeling reagent: due to the stability of the deuterium element, p-Xylene-d10 can be used as an internal standard substance in nuclear magnetic resonance (NMR) spectra to analyze the relative concentration and structure of other organic compounds.
3. Synthesis and catalytic reaction intermediates: p-Xylene-d10 can be used as catalysts and reaction intermediates in the process of synthesizing organic compounds, participating in the formation of carbon-carbon bonds and aromatic reactions.
The method of preparing p-Xylene-d10 generally uses a deuterated reactant to react with p-xylene and replace the hydrogen atoms therein. The specific preparation method can be achieved by reacting hydrogen with a deuterated reactant such as sodium dimethyl benzene or lithium dimethyl benzene.
For its safety information, p-Xylene-d10 is generally considered to be a relatively safe substance. However, during handling and use, it is still necessary to follow relevant laboratory safety procedures, such as wearing protective gloves and safety glasses, ensuring proper ventilation conditions, and avoiding contact with skin and eyes.
p-Xylene-d10 has a wide range of applications in scientific research and industrial production. Here are some of its main properties and uses:
1. Important solvent: p-Xylene-d10 is a non-polar solvent that can be used to dissolve many organic substances, especially in mass spectrometry.
2. labeling reagent: due to the stability of the deuterium element, p-Xylene-d10 can be used as an internal standard substance in nuclear magnetic resonance (NMR) spectra to analyze the relative concentration and structure of other organic compounds.
3. Synthesis and catalytic reaction intermediates: p-Xylene-d10 can be used as catalysts and reaction intermediates in the process of synthesizing organic compounds, participating in the formation of carbon-carbon bonds and aromatic reactions.
The method of preparing p-Xylene-d10 generally uses a deuterated reactant to react with p-xylene and replace the hydrogen atoms therein. The specific preparation method can be achieved by reacting hydrogen with a deuterated reactant such as sodium dimethyl benzene or lithium dimethyl benzene.
For its safety information, p-Xylene-d10 is generally considered to be a relatively safe substance. However, during handling and use, it is still necessary to follow relevant laboratory safety procedures, such as wearing protective gloves and safety glasses, ensuring proper ventilation conditions, and avoiding contact with skin and eyes.
Last Update：2024-04-10 22:29:15
Supplier List
View History
Raw Materials for p-Xylene-d10, Isotopic
Downstream Products for p-Xylene-d10, Isotopic