| Supplier Name | |
| Tel | 075527670086 |
| Mobile | 13534282526 |
| yolanda@vtolo.com | |
| Website | http://www.chemmkt.com |
| Product Name | Sebacic acid |
| Synonyms | SEBACIC ACID decanedioate Sebacic acid SEBACINIC ACID acidesebacique DECANEDIOIC ACID Decanedioic acid |
| CAS | 111-20-6 |
| EINECS | 203-845-5 |
| Chemical Formula | C10H18O4 |
| Molecular Weight | 202.25 |
| inchi | InChI=1/C10H18O4/c11-9(12)7-5-3-1-2-4-6-8-10(13)14/h1-8H2,(H,11,12)(H,13,14)/p-2 |
| Package | Email to quote |
| Price | Email to quote |
| Descriptions | |
| Last Update | 2023-04-27 18:30:20 |