| Supplier Name | |
| Tel | 0086-512-63009836 |
| Mobile | |
| linda@struchem.com | |
| Website | http://www.struchem.com |
| Product Name | 3-Hydroxyphenylacetic acid |
| Synonyms | (3-hydroxyphenyl)acetate 3-hydroxy-benzeneaceticaci 3-Hydroxyphenylacetic acid M-HYDROXYPHENYLACETIC ACID 3-HYDROXYPHENYLACETIC ACID M-hydroxyphenylacetic acid Benzeneacetic acid, 3-hydroxy- |
| CAS | 621-37-4 |
| EINECS | 210-684-4 |
| Chemical Formula | C8H8O3 |
| Molecular Weight | 152.15 |
| inchi | InChI=1/C8H8O3/c9-7-3-1-2-6(4-7)5-8(10)11/h1-4,9H,5H2,(H,10,11)/p-1 |
| Package | Email to quote |
| Price | Email to quote |
| Descriptions | |
| Supplier Website | |
| Last Update | 2023-04-27 18:30:20 |