| Supplier Name | |
| Tel | 010-84929330 |
| Mobile | |
| info@nordhuns.com | |
| Website | http://www.nordhuns.com |
| Product Name | 2-Chloromethyl-3-Methyl-4-Methoxypyridine Hydrochloride |
| Synonyms | Rabeprazole Mercapto Impurity 1 2-chloromethyl-3-methyl-4-methoxypyridine 2-(chloromethyl)-4-methoxy-3-methylpyridine 2-chloromethyl-4-methoxy-3-methylpyridine HCl Pyridine, 2-(chloromethyl)-4-methoxy-3-methyl |
| CAS | 124473-12-7 |
| EINECS | 1806241-263-5 |
| Chemical Formula | C8H10ClNO |
| Molecular Weight | 171.62 |
| inchi | InChI=1/C8H10ClNO/c1-6-7(5-9)10-4-3-8(6)11-2/h3-4H,5H2,1-2H3 |
| Package | Email to quote |
| Price | Email to quote |
| Descriptions | |
| Supplier Website | |
| Last Update | 2023-04-27 18:30:20 |