| Supplier Name | |
| Tel | 0535-6385396 |
| Mobile | 15653549902 |
| wujh@carbottpharm.com | |
| Website | http://www.carbottpharm.com |
| Product Name | 3-Methoxy-2-nitrobenzoic acid |
| Synonyms | RARECHEM AL BE 0677 2-NITRO-M-ANISIC ACID 2-Nitro-m-anisic acid m-Anisic acid, 2-nitro- 3-methoxy-2-nitrobenzoate 3-METHOXY-2-NITROBENZOIC ACID 3-Methoxy-2-nitrobenzoic acid |
| CAS | 4920-80-3 |
| EINECS | 225-549-5 |
| Chemical Formula | C8H7NO5 |
| Molecular Weight | 197.14 |
| inchi | InChI=1/C8H7NO5/c1-14-6-4-2-3-5(8(10)11)7(6)9(12)13/h2-4H,1H3,(H,10,11)/p-1 |
| Package | Email to quote |
| Price | Email to quote |
| Descriptions | |
| Last Update | 2023-04-27 18:30:20 |