| Supplier Name | |
| Tel | 0515-80855088 |
| Mobile | 18762539991 |
| sales04@gtaipeptide.com | |
| Website | http:// |
| Product Name | N-carbamyl-L-glutamic acid |
| Synonyms | NCG Carbaglu N-Cbm-Glu-OH Carglumic acid UNII-5L0HB4V1EW Ureidoglutaric acid N-Carbamylglutamate |
| CAS | 1188-38-1 |
| EINECS | 601-569-3 |
| Chemical Formula | C6H10N2O5 |
| Molecular Weight | 190.15 |
| inchi | InChI=1/C6H10N2O5/c7-6(13)8-3(5(11)12)1-2-4(9)10/h3H,1-2H2,(H,9,10)(H,11,12)(H3,7,8,13)/t3-/m0/s1 |
| Package | Email to quote |
| Price | Email to quote |
| Descriptions | |
| Supplier Website | |
| Last Update | 2023-04-27 18:30:20 |