| Supplier Name | |
| Tel | 027-83855393 |
| Mobile | 15827063722 |
| 2978041583@qq.com | |
| Website | http://www.hongdepharma.com/product.html |
| Product Name | Cyclopentylpropionyl chloride |
| Synonyms | AKOS BBS-00003910 Cyclopentylpropionyl chloride 3-CYCLOPENTYL PROPOYL CHLORIDE 3-CYCLOPENTYLPROPIONYL CHLORIDE 3-Cyclopentylpropionyl chloride 3-cyclopentylpropanoyl chloride 3-Cyclopentanepropionyl chloride |
| CAS | 104-97-2 |
| EINECS | 203-257-9 |
| Chemical Formula | C8H13ClO |
| Molecular Weight | 160.64 |
| inchi | InChI=1/C8H13ClO/c9-8(10)6-5-7-3-1-2-4-7/h7H,1-6H2 |
| Package | Email to quote |
| Price | Email to quote |
| Descriptions | |
| Last Update | 2023-04-27 18:30:20 |