| Supplier Name | |
| Tel | 15278871564 |
| Mobile | 18607870516 |
| 991463219@qq.com | |
| Website | https://shop7396y1672bj91.1688.com/?spm=a261y.7663282.autotrace-topNav.1.609749fdVygcN4 |
| Product Name | Ethyl acetate |
| Synonyms | RFE acetic ester Acetic Ether Ethyl acetate SPIRIT OF WINE METHYLCARBINOL REAGENT ALCOHOL |
| CAS | 141-78-6 |
| EINECS | 205-500-4 |
| Chemical Formula | C4H8O2 |
| Molecular Weight | 88.1051 |
| inchi | InChI=1/C4H8O2/c1-3-6-4(2)5/h3H2,1-2H3 |
| Package | 200kg |
| Price | Email to quote |
| Descriptions | |
| Last Update | 2023-04-27 18:30:20 |