| Supplier Name | Shanghai Yuli Biotechnology Co.,Ltd. |
| Tel | 13501999454 |
| Mobile | 13501999454 |
| yuki@yulibiotech.com | |
| Website | http://www.yulibiotech.com |
| Product Name | Ethyl N-(diphenylmethylene)glycinate |
| Synonyms | dpm-gly-oet DPM-Gly-OEt AURORA KA-6707 Ethyl N-benzhydrylideneglycinate diphenyl methylene glycine ester ETHYL (N-DIPHENYMETHYLENE)GLYCINATE ETHYL N-(DIPHENYLMETHYLENE)GLYCINATE |
| CAS | 69555-14-2 |
| EINECS | 614-987-6 |
| Chemical Formula | C17H17NO2 |
| Molecular Weight | 267.32 |
| inchi | InChI=1/C17H17NO2/c1-2-20-16(19)13-18-17(14-9-5-3-6-10-14)15-11-7-4-8-12-15/h3-12H,2,13H2,1H3 |
| Package | Email to quote |
| Price | Email to quote |
| Descriptions | |
| Supplier Website | |
| Last Update | 2023-04-27 18:30:20 |