Product Name | 2-Bromofluorobenzene |
Synonyms | o-fluorobromobenzene 2-BROMOFLUOROBENZENE 2-Bromofluorobenzene 2-Fluorobromobenzene 1-Bromo-2-fluorobenzene O-BROMO-2-FLUOROBENZENE 2-BROMO-1-FLUORO-BENZENE |
CAS | 1072-85-1 |
EINECS | 214-018-3 |
Chemical Formula | C6H4BrF |
Molecular Weight | 175 |
inchi | InChI=1/C6H4BrF/c7-5-3-1-2-4-6(5)8/h1-4H |
Package | 25KG/Drum |
Price | RFQ |
Descriptions | 2-Bromofluorobenzene is a light yellow liquid. Boiling point 155 ℃ -157 ℃, flash point 43 ℃, refractive index 1.5340, specific gravity 1.601. 2-fluorobromobenzene is mainly used as an intermediate in pharmaceuticals and pesticides. It can also be used as thickener, thickener, emulsifier, stabilizer, forming agent, and suspension agent, and is widely used in industries such as petroleum, chemical, food, papermaking, light industry, textile, dye, medicine, agriculture, ceramics, etc. |
Last Update | 2024-11-05 09:57:44 |