| Supplier Name | Guangzhou Zhaoxi Biotechnology Co. LTD |
| Tel | |
| Mobile | 13059396489 |
| yaoliteng@azcxswkjwwgc.onexmail.com | |
| Website | http://zhaoxibiotech.1688.com/ |
| Product Name | Vanillyl Butyl Ether |
| Synonyms | FEMA 3796 4O1R DQ CO1 Vanillyl Butyl Ether BUTYL VANILLYL ETHER VANILLYL BUTYL ETHER 4-BUTOXY-2-METHOXYPHENOL 4-(Butoxymethyl)-2-methoxyphenol |
| CAS | 82654-98-6 |
| EINECS | 209-753-1 |
| Chemical Formula | C12H18O3 |
| Molecular Weight | 210.27 |
| inchi | InChI=1/C12H18O3/c1-3-4-7-15-9-10-5-6-11(13)12(8-10)14-2/h5-6,8,13H,3-4,7,9H2,1-2H3 |
| Package | Email to quote |
| Price | Email to quote |
| Descriptions | |
| Supplier Website | |
| Last Update | 2023-04-27 18:30:20 |