| Supplier Name | XiangYang King Success Fine Chemical co., ltd. |
| Tel | 0710-3510276 |
| Mobile | 19871282568 |
| sales_kingsuccess@163.com | |
| Website | http://www.king-success.com/ |
| Product Name | 2-Diethylaminoethylchloride hydrochloride |
| Synonyms | TRISMETHOXYBENZENE 3,5-DIMETHOXYANISOLE 2-Chlorotriethylaminehydrochl 2-chloro-triethylaminhydrochloride 2-Chlorotriethylamine hydrochloride 2-Diethylaminoethylchloride hydrochloride 2-chloro-n,n-diethyl-ethanaminhydrochloride |
| CAS | 869-24-9 |
| EINECS | 212-786-4 |
| Chemical Formula | C6H15Cl2N |
| Molecular Weight | 172.1 |
| inchi | InChI=1/C6H14ClN/c1-3-8(4-2)6-5-7/h3-6H2,1-2H3/p+1 |
| Package | Email to quote |
| Price | Email to quote |
| Descriptions | |
| Supplier Website | |
| Last Update | 2023-04-27 18:30:20 |