| Supplier Name | Wanyin (Hebei) new material technology Co., Ltd |
| Tel | |
| Mobile | 13013270101 |
| wanyinhuagong@163.com | |
| Website | http://hbwanyin.com |
| Product Name | N,N-dimethylhexadecylamine |
| Synonyms | DMA1697 Adma 16 bairdcatb16 Barlene(R) 16S Zephirol Impurity 5 N-Cetyldimethylamine Hexadecyldimethylamin |
| CAS | 112-69-6;75444-69-8 |
| EINECS | 203-997-2 |
| Chemical Formula | C18H39N |
| Molecular Weight | 269.51 |
| inchi | InChI=1/C18H39N/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(2)3/h4-18H2,1-3H3 |
| Package | Email to quote |
| Price | Email to quote |
| Descriptions | |
| Supplier Website | |
| Last Update | 2023-04-27 18:30:20 |