| Supplier Name | Wuxi kaiLi biotech Limited |
| Tel | 051080721533 |
| Mobile | 13327925606 |
| sales@klbiotech.com | |
| Website | http://www.kaili-chem.com |
| Product Name | N,N-Di(2-hydroxyethyl)-2-methyl-1,3-phenylenediamine |
| Synonyms | hc purple bs 2,6-Dihydroxyethylamino-toluene 2,6-di(2-hydroxyethylamino)toluene 2,6-Bis(β-hydroxyethylamino)toluene 2,6-bis[(2-hydroxyethyl)amino]toluene 2,6-N,N-(2-hydroxyethyl)diaminotoluene |
| CAS | 149330-25-6 |
| EINECS | |
| Chemical Formula | C11H18N2O2 |
| Molecular Weight | 210.27 |
| inchi | InChI=1/C11H18N2O2/c1-9-10(12-5-7-14)3-2-4-11(9)13-6-8-15/h2-4,12-15H,5-8H2,1H3 |
| Package | Email to quote |
| Price | Email to quote |
| Descriptions | |
| Supplier Website | |
| Last Update | 2023-04-27 18:30:20 |