| Supplier Name | Hangzhou Foreign Economic Relations and Trade Service Co Ltd |
| Tel | |
| Mobile | 13957167880 |
| triggerchem@126.com | |
| Website | http://www.triggerchem.cn |
| Product Name | 5-Chloro-2-Methyl-4-Isothiazolin-3-One |
| Synonyms | CIT CMIT Paretol Acticide Grotan K Metat GT Mergal K7 |
| CAS | 26172-55-4 |
| EINECS | 247-500-7 |
| Chemical Formula | C4H4ClNOS和C4H5NOS |
| Molecular Weight | 186.06 |
| inchi | InChI=1/C4H4ClNOS.ClH/c1-6-4(7)2-3(5)8-6;/h2H,1H3;1H |
| Package | Email to quote |
| Price | Email to quote |
| Descriptions | |
| Last Update | 2023-04-27 18:30:20 |