| Supplier Name | Wuhan Kaimubuke Pharmaceutical Technology Co., |
| Tel | |
| Mobile | 16631161866 |
| bella@whkmbk.com | |
| Website | http:// |
| Product Name | xylazine free base |
| Synonyms | xylazine Xylazine base Xylazine (200 mg) xylazine free base Xylazine (free base) 5,6-dihydro-2-(2,6-xylidino)-4h-3-thiazine 5,6-dihydro-2-(2,6-xylidino)-4h-1,3-thiazine |
| CAS | 7361-61-7 |
| EINECS | 230-902-1 |
| Chemical Formula | C12H16N2S |
| Molecular Weight | 220.33 |
| inchi | InChI=1/C12H16N2S/c1-9-5-3-6-10(2)11(9)14-12-13-7-4-8-15-12/h3,5-6H,4,7-8H2,1-2H3,(H,13,14) |
| Package | Email to quote |
| Price | Email to quote |
| Descriptions | |
| Last Update | 2023-04-27 18:30:20 |