| Supplier Name | Wuhan De Yuan Cheng Biological Technology Co., Ltd |
| Tel | 02787887055 |
| Mobile | 18971192287 |
| 307906085@qq.com | |
| Website | http://www.dyc-biochem.com/ |
| Product Name | faropenem sodium |
| Synonyms | alp201 fropenumsodium faropenem sodium Faropenem sodium hydrate (5r,6s)-6-(1(r)-hydroxyethyl)-2-(2(r)-tetrahydrofuryl)penem-3-carboxylicacid (5R,6S,8R,2′R)-2-(2′-tetrahydrofuryl)-6-hydroxyethylpenem-3-carboxylate sodium salt |
| CAS | 122547-49-3 |
| EINECS | 1592732-453-0 |
| Chemical Formula | C12H14NO5S.Na |
| Molecular Weight | 307.3 |
| inchi | InChI=1/C12H15NO5S.Na/c1-5(14)7-10(15)13-8(12(16)17)9(19-11(7)13)6-3-2-4-18-6;/h5-7,11,14H,2-4H2,1H3,(H,16,17);/q;+1/p-1/t5-,6-,7+,11-;/m1./s1 |
| Package | Email to quote |
| Price | Email to quote |
| Descriptions | |
| Supplier Website | |
| Last Update | 2023-04-27 18:30:20 |