| Supplier Name | Henan Research New Material Co., Ltd |
| Tel | |
| Mobile | +86 18137458807 |
| sales021@researchvip.com | |
| Website | http://www.researchvip.com |
| Product Name | 2-norbornanemethanol, mixture of endo and ex |
| Synonyms | Norbornanemethanol 2-Norbornylmethanol TIMTEC-BB SBB008210 2-Norcamphanemethanol Norbornane-2-methanol 2-Norkamfanylmethanol NORBORNANE-2-METHANOL |
| CAS | 5240-72-2 |
| EINECS | 226-041-6 |
| Chemical Formula | C8H14O |
| Molecular Weight | 126.2 |
| inchi | InChI=1/C8H14O/c9-5-8-4-6-1-2-7(8)3-6/h6-9H,1-5H2/t6-,7+,8-/m1/s1 |
| Package | Email to quote |
| Price | Email to quote |
| Descriptions | |
| Last Update | 2023-04-27 18:30:20 |