| Supplier Name | Zhuhai Long Success Chemical Industry Co Ltd |
| Tel | |
| Mobile | |
| sales@LSChem.com.cn | |
| Website | http://lschem.com.cn |
| Product Name | 4-Methyl-2-pentanone |
| Synonyms | MIBK Hexone Isopropylacetone 4-Methyl-2-pentanone 4-methylpentan-2-one Methyl isobuty ketone Methyl isobutyl keton |
| CAS | 108-10-1 |
| EINECS | 203-550-1 |
| Chemical Formula | C6H12O |
| Molecular Weight | 100.16 |
| inchi | InChI=1/C6H12O/c1-5(2)4-6(3)7/h5H,4H2,1-3H3 |
| Package | Email to quote |
| Price | Email to quote |
| Descriptions | |
| Last Update | 2023-04-27 18:30:20 |