| Supplier Name | Wuhan Shuer Biological Technology Co., Ltd. |
| Tel | 13277972784 |
| Mobile | 13277972784 |
| Website | http:// |
| Product Name | 2,2',4,4'-Tetrehydroxybenzophenone |
| Synonyms | Benzophenone 2 Benzophenone-2 2,2,4,4-Tetrahydroxybenzophenol Di(2,4-dihydroxyphenyl)methanone 2,2,4,4 TETRAHYDROXY BENZOPHENONE bis(2,4-dihydroxyphenyl)-methanon bis(2,4-dihydroxyphenyl)methanone |
| CAS | 131-55-5 |
| EINECS | 205-028-9 |
| Chemical Formula | C13H10O5 |
| Molecular Weight | 246.22 |
| inchi | InChI=1/C13H10O5/c14-7-1-3-9(11(16)5-7)13(18)10-4-2-8(15)6-12(10)17/h1-6,14-17H |
| Package | Email to quote |
| Price | Email to quote |
| Descriptions | |
| Supplier Website | |
| Last Update | 2023-04-27 18:30:20 |