| Supplier Name | Wuhan Shuer Biological Technology Co., Ltd. |
| Tel | 13277972784 |
| Mobile | 13277972784 |
| Website | http:// |
| Product Name | 2,4-Dihydroxybenzophenone |
| Synonyms | BP-1 UV-0 Benzophenone-1 Benzoresorcinol Resbenzophenone 4-benzoylresorcinol Ultraviolet absorber UV-0 |
| CAS | 131-56-6 |
| EINECS | 205-029-4 |
| Chemical Formula | C13H10O3 |
| Molecular Weight | 214.22 |
| inchi | InChI=1/C13H10O3/c14-10-6-7-11(12(15)8-10)13(16)9-4-2-1-3-5-9/h1-8,14-15H |
| Package | Email to quote |
| Price | Email to quote |
| Descriptions | |
| Supplier Website | |
| Last Update | 2023-04-27 18:30:20 |