| Supplier Name | Anhui Shun Lee Biology Co., Ltd. |
| Tel | 0512-57376087 |
| Mobile | 15240404103 |
| kim@traxmic.com | |
| Website | http://www.traxmic.com |
| Product Name | 4-Butylresorcinol |
| Synonyms | 4-Butylresorcinol 4-N-BUTYLRESORCINOL 4-Butylbenzene-1,3-diol 4-phenylbutane-1,3-diol 1,3-Benzenediol,4-butyl- 2,4-Dihydroxy-n-bytyl benzen 2,4-DIHYDROXY-N-BUTYL BENZEN |
| CAS | 18979-61-8 |
| EINECS | |
| Chemical Formula | C10H14O2 |
| Molecular Weight | 166.22 |
| inchi | InChI=1/C10H14O2/c1-2-3-4-8-5-6-9(11)7-10(8)12/h5-7,11-12H,2-4H2,1H3 |
| Package | Email to quote |
| Price | Email to quote |
| Descriptions | |
| Supplier Website | |
| Last Update | 2023-04-27 18:30:20 |