| Supplier Name | HUBEI VANZPHARM INC. |
| Tel | 027-84492310 |
| Mobile | 18171127676 |
| 3289009880@qq.com | |
| Website | http://www.vanzpharm.com |
| Product Name | Pirfenidone |
| Synonyms | S-7701 Pirfenidone Pirfenidone(S-7701,AMR-69) 5-methyl-1-phenyl-2-pyridone 5-methyl-1-phenylpyridin-2-one 5-methyl-1-phenyl-pyridin-2-one 5-Methyl-1-phenyl-2-(1H)-pyridone |
| CAS | 53179-13-8 |
| EINECS | 621-260-7 |
| Chemical Formula | C12H11NO |
| Molecular Weight | 185.22 |
| inchi | InChI=1/C12H11NO/c1-10-7-8-12(14)13(9-10)11-5-3-2-4-6-11/h2-9H,1H3 |
| Package | Email to quote |
| Price | Email to quote |
| Descriptions | |
| Supplier Website | |
| Last Update | 2023-04-27 18:30:20 |