| Supplier Name | |
| Tel | 18117456465 |
| Mobile | 18117456465 |
| 18117456465m@sina.cn | |
| Website | https://www.51chem.com |
| Product Name | Potassium carbonate |
| Synonyms | K2CO3 Pearl ash Salt of tartar alt of wormwood Potassiumcarbonate Potassium carbonate Carbonate Of Potash |
| CAS | 584-08-7 |
| EINECS | 209-529-3 |
| Chemical Formula | K2CO3 |
| Molecular Weight | 138.21 |
| inchi | InChI=1/CH2O3.2K.2H/c2-1(3)4;;;;/h(H2,2,3,4);;;;/p-2/rCH2O3.2HK/c2-1(3)4;;/h(H2,2,3,4);2*1H/p-2 |
| Package | 25kg |
| Price | Email to quote |
| Descriptions | |
| Supplier Website | |
| Last Update | 2023-04-27 18:30:20 |