| Supplier Name | Shandong Chemed Pharmaceutical Co., Ltd. |
| Tel | |
| Mobile | 13256704711 |
| chemedpharma@163.com | |
| Website | http://www.chemedpharma.com/ |
| Product Name | dexmedetomidine HCL |
| Synonyms | DEMEDETOMIDINE HCL demedetomidine HCL DEXMEDETOMIDINE HCL dexmedetomidine HCL Dexmedetomidine(Pilot) Dexmedetomidine Hydrochloride DEXMEDETOMIDINE HYDROCHLORIDE |
| CAS | 145108-58-3 |
| EINECS | 682-047-2 |
| Chemical Formula | C13H17ClN2 |
| Molecular Weight | 236.74 |
| inchi | InChI=1/C13H16N2.ClH/c1-9-5-4-6-12(10(9)2)11(3)13-7-14-8-15-13;/h4-8,11H,1-3H3,(H,14,15);1H/t11-;/m0./s1 |
| Package | Email to quote |
| Price | Email to quote |
| Descriptions | |
| Last Update | 2023-04-27 18:30:20 |