| Supplier Name | Shanghai Hanhong chemical Co.Ltd. |
| Tel | 021-54300995 |
| Mobile | 13916351815 |
| moresun@hanhonggroup.com | |
| Website | http://www.hanhonggroup.com/en/ |
| Product Name | D-Proline |
| Synonyms | D-Pro-OH D-Proline H-D-Pro-OH D(+)-PROLINE D-(+)-Proline (R)-(+)-PROLINE D-2-PYRROLIDINECARBOXYLIC ACID |
| CAS | 344-25-2 |
| EINECS | 206-452-7 |
| Chemical Formula | C5H9NO2 |
| Molecular Weight | 115.13 |
| inchi | InChI=1/C5H9NO2/c7-5(8)4-2-1-3-6-4/h4,6H,1-3H2,(H,7,8)/t4-/m1/s1 |
| Package | Email to quote |
| Price | Email to quote |
| Descriptions | |
| Supplier Website | |
| Last Update | 2023-04-27 18:30:20 |