Request for quotation
Supplier Contact
 | |
| Supplier Name | dechi |
| Contact | Mr. zhang |
| Tel | 18669681830 |
| Mobile | 18669681830 |
| 2229890238 | |
| dechi1118@163.com | |
| Website | http://www.sddechi.com |
| Product Name | 4-Nitrobenzyl chloroformate |
| Synonyms | PNZ PNBCF 4-Nitrocarbobenzoxychloride P-nitrobenzyl chloroformate P-NITROBENZYL CHLOROFORMATE 4-Nitrobenzyl chloroformate P-NITROCARBOBENZOXY CHLORIDE |
| CAS | 4457-32-3 |
| EINECS | 224-708-6 |
| Chemical Formula | C8H6ClNO4 |
| Molecular Weight | 215.59 |
| inchi | InChI=1/C8H6ClNO4/c9-8(11)14-5-6-1-3-7(4-2-6)10(12)13/h1-4H,5H2 |
| Package | Email to quote |
| Price | Email to quote |
| Descriptions | |
| Last Update | 2024-11-22 10:27:15 |