Product Name | 1-deoxy-1-(octylamino)-D-glucitol |
Synonyms | N-OCTYLGLUCAMINE N-n-octylglucamine N-Octyl-D-glucamine N-N-OCTYL-D-GLUCAMINE 1-deoxy-1-(octylamino)hexitol 1-Octylamino-1-deoxy-D-glucitol 1-DEOXY-1-(OCTYLAMINO)-D-GLUCITOL |
CAS | 23323-37-7 |
EINECS | 245-582-9 |
Chemical Formula | C14H31NO5 |
Molecular Weight | 293.4 |
inchi | InChI=1/C14H31NO5/c1-2-3-4-5-6-7-8-15-9-11(17)13(19)14(20)12(18)10-16/h11-20H,2-10H2,1H3 |
Package | 25KG/Drum |
Price | RFQ |
Descriptions | Glucosamine is a enantiomer used for the separation of chiral drugs and pesticides such as non steroidal anti-inflammatory and analgesic drugs Naproxen, Ibuprofen, and Metalaxyl. |
Last Update | 2024-11-13 10:25:16 |